C21H35NO5S — CID 90677530
(1S,9R,13S)-13-(3-hydroxy-3-methylpentyl)-1,10-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-ol;methanesulfonic acid (PubChem CID 90677530) has the molecular formula C21H35NO5S and a molecular weight of 413.58 g/mol. Its IUPAC name is (1S,9R,13S)-13-(3-hydroxy-3-methylpentyl)-1,10-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-ol;methanesulfonic acid.
| Compound Name | (1S,9R,13S)-13-(3-hydroxy-3-methylpentyl)-1,10-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-ol;methanesulfonic acid |
|---|---|
| PubChem CID | 90677530 |
| Molecular Formula | C21H35NO5S |
| Molecular Weight | 413.58 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | (1S,9R,13S)-13-(3-hydroxy-3-methylpentyl)-1,10-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-ol;methanesulfonic acid |
| SMILES | CCC(C)(O)CC[C@@H]1[C@H]2Cc3ccc(O)cc3[C@@]1(C)CCN2C.CS(=O)(=O)O |
| InChI | InChI=1S/C20H31NO2.CH4O3S/c1-5-19(2,23)9-8-16-18-12-14-6-7-15(22)13-17(14)20(16,3)10-11-21(18)4;1-5(2,3)4/h6-7,13,16,18,22-23H,5,8-12H2,1-4H3;1H3,(H,2,3,4)/t16-,18-,19?,20+;/m1./s1 |
| InChIKey | QBUFINDIIKTHAM-CGMRGJQTSA-N |
| XLogP | 2.97 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.58 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|