C22H35NO2 — CID 90677535
(1S,9R,13S)-13-(3-hydroxy-3-methylheptyl)-1,10-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-ol (PubChem CID 90677535) has the molecular formula C22H35NO2 and a molecular weight of 345.53 g/mol. Its IUPAC name is (1S,9R,13S)-13-(3-hydroxy-3-methylheptyl)-1,10-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-ol.
| Compound Name | (1S,9R,13S)-13-(3-hydroxy-3-methylheptyl)-1,10-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-ol |
|---|---|
| PubChem CID | 90677535 |
| Molecular Formula | C22H35NO2 |
| Molecular Weight | 345.53 g/mol |
| Exact Mass | 345.27 |
| IUPAC Name | (1S,9R,13S)-13-(3-hydroxy-3-methylheptyl)-1,10-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-ol |
| SMILES | CCCCC(C)(O)CC[C@@H]1[C@H]2Cc3ccc(O)cc3[C@@]1(C)CCN2C |
| InChI | InChI=1S/C22H35NO2/c1-5-6-10-21(2,25)11-9-18-20-14-16-7-8-17(24)15-19(16)22(18,3)12-13-23(20)4/h7-8,15,18,20,24-25H,5-6,9-14H2,1-4H3/t18-,20-,21?,22+/m1/s1 |
| InChIKey | PDQSXWZALABJLC-PUSAOEICSA-N |
| XLogP | 4.25 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.53 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |