C23H39NO5S — CID 90677536
(1S,9R,13S)-13-(3-hydroxy-3,4,4-trimethylpentyl)-1,10-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-ol;methanesulfonic acid (PubChem CID 90677536) has the molecular formula C23H39NO5S and a molecular weight of 441.63 g/mol. Its IUPAC name is (1S,9R,13S)-13-(3-hydroxy-3,4,4-trimethylpentyl)-1,10-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-ol;methanesulfonic acid.
| Compound Name | (1S,9R,13S)-13-(3-hydroxy-3,4,4-trimethylpentyl)-1,10-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-ol;methanesulfonic acid |
|---|---|
| PubChem CID | 90677536 |
| Molecular Formula | C23H39NO5S |
| Molecular Weight | 441.63 g/mol |
| Exact Mass | 441.25 |
| IUPAC Name | (1S,9R,13S)-13-(3-hydroxy-3,4,4-trimethylpentyl)-1,10-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-ol;methanesulfonic acid |
| SMILES | CN1CC[C@]2(C)c3cc(O)ccc3C[C@@H]1[C@H]2CCC(C)(O)C(C)(C)C.CS(=O)(=O)O |
| InChI | InChI=1S/C22H35NO2.CH4O3S/c1-20(2,3)22(5,25)10-9-17-19-13-15-7-8-16(24)14-18(15)21(17,4)11-12-23(19)6;1-5(2,3)4/h7-8,14,17,19,24-25H,9-13H2,1-6H3;1H3,(H,2,3,4)/t17-,19-,21+,22?;/m1./s1 |
| InChIKey | XVQLRXGXSFKZDV-IBVVVPICSA-N |
| XLogP | 3.61 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.63 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|