C24H41NO5S — CID 90677539
(1R,9R,13S)-13-(3-hydroxy-3,4,4-trimethylpentyl)-1,10,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-ol;methanesulfonic acid (PubChem CID 90677539) has the molecular formula C24H41NO5S and a molecular weight of 455.66 g/mol. Its IUPAC name is (1R,9R,13S)-13-(3-hydroxy-3,4,4-trimethylpentyl)-1,10,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-ol;methanesulfonic acid.
| Compound Name | (1R,9R,13S)-13-(3-hydroxy-3,4,4-trimethylpentyl)-1,10,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-ol;methanesulfonic acid |
|---|---|
| PubChem CID | 90677539 |
| Molecular Formula | C24H41NO5S |
| Molecular Weight | 455.66 g/mol |
| Exact Mass | 455.27 |
| IUPAC Name | (1R,9R,13S)-13-(3-hydroxy-3,4,4-trimethylpentyl)-1,10,13-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-ol;methanesulfonic acid |
| SMILES | CN1CC[C@]2(C)c3cc(O)ccc3C[C@@H]1[C@@]2(C)CCC(C)(O)C(C)(C)C.CS(=O)(=O)O |
| InChI | InChI=1S/C23H37NO2.CH4O3S/c1-20(2,3)23(6,26)11-10-22(5)19-14-16-8-9-17(25)15-18(16)21(22,4)12-13-24(19)7;1-5(2,3)4/h8-9,15,19,25-26H,10-14H2,1-7H3;1H3,(H,2,3,4)/t19-,21-,22-,23?;/m1./s1 |
| InChIKey | GFYRTTSVQGNDFU-ODRWLXPRSA-N |
| XLogP | 4.00 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.66 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|