C18H27NO4 — CID 90677611
(1R,14R)-11,14-dimethyl-11-azatricyclo[7.4.1.02,7]tetradeca-2(7),3,5-trien-4-ol;2-hydroxypropanoic acid (PubChem CID 90677611) has the molecular formula C18H27NO4 and a molecular weight of 321.42 g/mol. Its IUPAC name is (1R,14R)-11,14-dimethyl-11-azatricyclo[7.4.1.02,7]tetradeca-2(7),3,5-trien-4-ol;2-hydroxypropanoic acid.
| Compound Name | (1R,14R)-11,14-dimethyl-11-azatricyclo[7.4.1.02,7]tetradeca-2(7),3,5-trien-4-ol;2-hydroxypropanoic acid |
|---|---|
| PubChem CID | 90677611 |
| Molecular Formula | C18H27NO4 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | (1R,14R)-11,14-dimethyl-11-azatricyclo[7.4.1.02,7]tetradeca-2(7),3,5-trien-4-ol;2-hydroxypropanoic acid |
| SMILES | CC(O)C(=O)O.C[C@H]1C2Cc3ccc(O)cc3[C@@H]1CCN(C)C2 |
| InChI | InChI=1S/C15H21NO.C3H6O3/c1-10-12-7-11-3-4-13(17)8-15(11)14(10)5-6-16(2)9-12;1-2(4)3(5)6/h3-4,8,10,12,14,17H,5-7,9H2,1-2H3;2,4H,1H3,(H,5,6)/t10-,12?,14+;/m0./s1 |
| InChIKey | QIZJRLQDIVBKKK-OCVFOAOLSA-N |
| XLogP | 2.07 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |