About N-[1-[2,6-diamino-5-(4-chlorophenyl)pyrimidin-4-yl]ethyl]acetamide
N-[1-[2,6-diamino-5-(4-chlorophenyl)pyrimidin-4-yl]ethyl]acetamide (PubChem CID 90677858) has the molecular formula C14H16ClN5O
and a molecular weight of 305.77 g/mol. Its IUPAC name is N-[1-[2,6-diamino-5-(4-chlorophenyl)pyrimidin-4-yl]ethyl]acetamide.
Molecular Properties
| Compound Name | N-[1-[2,6-diamino-5-(4-chlorophenyl)pyrimidin-4-yl]ethyl]acetamide |
| PubChem CID | 90677858 |
| Molecular Formula | C14H16ClN5O |
| Molecular Weight | 305.77 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | N-[1-[2,6-diamino-5-(4-chlorophenyl)pyrimidin-4-yl]ethyl]acetamide |
| SMILES | CC(=O)NC(C)c1nc(N)nc(N)c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H16ClN5O/c1-7(18-8(2)21)12-11(13(16)20-14(17)19-12)9-3-5-10(15)6-4-9/h3-7H,1-2H3,(H,18,21)(H4,16,17,19,20) |
| InChIKey | ODANDLYGGJQSAF-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.77 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[1-[2,6-diamino-5-(4-chlorophenyl)pyrimidin-4-yl]ethyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-[2,6-diamino-5-(4-chlorophenyl)pyrimidin-4-yl]ethyl]acetamide?
The IUPAC name of N-[1-[2,6-diamino-5-(4-chlorophenyl)pyrimidin-4-yl]ethyl]acetamide (CID 90677858) is N-[1-[2,6-diamino-5-(4-chlorophenyl)pyrimidin-4-yl]ethyl]acetamide.
What is the SMILES notation for N-[1-[2,6-diamino-5-(4-chlorophenyl)pyrimidin-4-yl]ethyl]acetamide?
The canonical SMILES for N-[1-[2,6-diamino-5-(4-chlorophenyl)pyrimidin-4-yl]ethyl]acetamide is CC(=O)NC(C)c1nc(N)nc(N)c1-c1ccc(Cl)cc1.
What is the InChIKey of N-[1-[2,6-diamino-5-(4-chlorophenyl)pyrimidin-4-yl]ethyl]acetamide?
The InChIKey is ODANDLYGGJQSAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16ClN5O/c1-7(18-8(2)21)12-11(13(16)20-14(17)19-12)9-3-5-10(15)6-4-9/h3-7H,1-2H3,(H,18,21)(H4,16,17,19,20).
What are the key properties of N-[1-[2,6-diamino-5-(4-chlorophenyl)pyrimidin-4-yl]ethyl]acetamide?
N-[1-[2,6-diamino-5-(4-chlorophenyl)pyrimidin-4-yl]ethyl]acetamide has a molecular weight of 305.77 g/mol, XLogP of 2.16, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-[2,6-diamino-5-(4-chlorophenyl)pyrimidin-4-yl]ethyl]acetamide is sourced from PubChem (CID 90677858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).