C20H30ClNO — CID 90677935
2-[benzyl(butyl)amino]-2,3,4,5,6,7-hexahydro-1H-inden-5-ol;hydrochloride (PubChem CID 90677935) has the molecular formula C20H30ClNO and a molecular weight of 335.92 g/mol. Its IUPAC name is 2-[benzyl(butyl)amino]-2,3,4,5,6,7-hexahydro-1H-inden-5-ol;hydrochloride.
| Compound Name | 2-[benzyl(butyl)amino]-2,3,4,5,6,7-hexahydro-1H-inden-5-ol;hydrochloride |
|---|---|
| PubChem CID | 90677935 |
| Molecular Formula | C20H30ClNO |
| Molecular Weight | 335.92 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | 2-[benzyl(butyl)amino]-2,3,4,5,6,7-hexahydro-1H-inden-5-ol;hydrochloride |
| SMILES | CCCCN(Cc1ccccc1)C1CC2=C(CC(O)CC2)C1.Cl |
| InChI | InChI=1S/C20H29NO.ClH/c1-2-3-11-21(15-16-7-5-4-6-8-16)19-12-17-9-10-20(22)14-18(17)13-19;/h4-8,19-20,22H,2-3,9-15H2,1H3;1H |
| InChIKey | MSDXOAMBJCVCOG-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.92 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|