C17H28BrNO — CID 90677944
1-(3-piperidin-1-ylpropyl)-2,3,4,7-tetrahydro-1H-inden-2-ol;hydrobromide (PubChem CID 90677944) has the molecular formula C17H28BrNO and a molecular weight of 342.32 g/mol. Its IUPAC name is 1-(3-piperidin-1-ylpropyl)-2,3,4,7-tetrahydro-1H-inden-2-ol;hydrobromide.
| Compound Name | 1-(3-piperidin-1-ylpropyl)-2,3,4,7-tetrahydro-1H-inden-2-ol;hydrobromide |
|---|---|
| PubChem CID | 90677944 |
| Molecular Formula | C17H28BrNO |
| Molecular Weight | 342.32 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 1-(3-piperidin-1-ylpropyl)-2,3,4,7-tetrahydro-1H-inden-2-ol;hydrobromide |
| SMILES | Br.OC1CC2=C(CC=CC2)C1CCCN1CCCCC1 |
| InChI | InChI=1S/C17H27NO.BrH/c19-17-13-14-7-2-3-8-15(14)16(17)9-6-12-18-10-4-1-5-11-18;/h2-3,16-17,19H,1,4-13H2;1H |
| InChIKey | WGUYSKSJKXEWLZ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.32 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|