C15H26ClNO — CID 90677945
1-[3-(dimethylamino)propyl]-1,2,3,4,5,8-hexahydronaphthalen-2-ol;hydrochloride (PubChem CID 90677945) has the molecular formula C15H26ClNO and a molecular weight of 271.83 g/mol. Its IUPAC name is 1-[3-(dimethylamino)propyl]-1,2,3,4,5,8-hexahydronaphthalen-2-ol;hydrochloride.
| Compound Name | 1-[3-(dimethylamino)propyl]-1,2,3,4,5,8-hexahydronaphthalen-2-ol;hydrochloride |
|---|---|
| PubChem CID | 90677945 |
| Molecular Formula | C15H26ClNO |
| Molecular Weight | 271.83 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | 1-[3-(dimethylamino)propyl]-1,2,3,4,5,8-hexahydronaphthalen-2-ol;hydrochloride |
| SMILES | CN(C)CCCC1C2=C(CC=CC2)CCC1O.Cl |
| InChI | InChI=1S/C15H25NO.ClH/c1-16(2)11-5-8-14-13-7-4-3-6-12(13)9-10-15(14)17;/h3-4,14-15,17H,5-11H2,1-2H3;1H |
| InChIKey | CWZYEVHCQYGUBK-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.83 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|