About [2-(2,4-dioxo-1H-pyrimidin-5-yl)-2-oxoethyl]-trimethylazanium bromide
[2-(2,4-dioxo-1H-pyrimidin-5-yl)-2-oxoethyl]-trimethylazanium bromide (PubChem CID 90677959) has the molecular formula C9H14BrN3O3
and a molecular weight of 292.13 g/mol. Its IUPAC name is [2-(2,4-dioxo-1H-pyrimidin-5-yl)-2-oxoethyl]-trimethylazanium bromide.
Molecular Properties
| Compound Name | [2-(2,4-dioxo-1H-pyrimidin-5-yl)-2-oxoethyl]-trimethylazanium bromide |
| PubChem CID | 90677959 |
| Molecular Formula | C9H14BrN3O3 |
| Molecular Weight | 292.13 g/mol |
| Exact Mass | 291.02 |
| IUPAC Name | [2-(2,4-dioxo-1H-pyrimidin-5-yl)-2-oxoethyl]-trimethylazanium bromide |
| SMILES | C[N+](C)(C)CC(=O)c1c[nH]c(=O)[nH]c1=O.[Br-] |
| InChI | InChI=1S/C9H13N3O3.BrH/c1-12(2,3)5-7(13)6-4-10-9(15)11-8(6)14;/h4H,5H2,1-3H3,(H-,10,11,13,14,15);1H |
| InChIKey | XNCIQMSGMQYEFB-UHFFFAOYSA-N |
| XLogP | -4.04 |
| TPSA | 82.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.13 |
| LogP ≤ 5 | -4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze [2-(2,4-dioxo-1H-pyrimidin-5-yl)-2-oxoethyl]-trimethylazanium bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2,4-dioxo-1H-pyrimidin-5-yl)-2-oxoethyl]-trimethylazanium bromide?
The IUPAC name of [2-(2,4-dioxo-1H-pyrimidin-5-yl)-2-oxoethyl]-trimethylazanium bromide (CID 90677959) is [2-(2,4-dioxo-1H-pyrimidin-5-yl)-2-oxoethyl]-trimethylazanium bromide.
What is the SMILES notation for [2-(2,4-dioxo-1H-pyrimidin-5-yl)-2-oxoethyl]-trimethylazanium bromide?
The canonical SMILES for [2-(2,4-dioxo-1H-pyrimidin-5-yl)-2-oxoethyl]-trimethylazanium bromide is C[N+](C)(C)CC(=O)c1c[nH]c(=O)[nH]c1=O.[Br-].
What is the InChIKey of [2-(2,4-dioxo-1H-pyrimidin-5-yl)-2-oxoethyl]-trimethylazanium bromide?
The InChIKey is XNCIQMSGMQYEFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3O3.BrH/c1-12(2,3)5-7(13)6-4-10-9(15)11-8(6)14;/h4H,5H2,1-3H3,(H-,10,11,13,14,15);1H.
What are the key properties of [2-(2,4-dioxo-1H-pyrimidin-5-yl)-2-oxoethyl]-trimethylazanium bromide?
[2-(2,4-dioxo-1H-pyrimidin-5-yl)-2-oxoethyl]-trimethylazanium bromide has a molecular weight of 292.13 g/mol, XLogP of -4.04, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2,4-dioxo-1H-pyrimidin-5-yl)-2-oxoethyl]-trimethylazanium bromide is sourced from PubChem (CID 90677959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).