About 4-amino-5-[1-(aminomethyl)cyclopentyl]benzene-1,2-diol;hydrobromide
4-amino-5-[1-(aminomethyl)cyclopentyl]benzene-1,2-diol;hydrobromide (PubChem CID 90678002) has the molecular formula C12H19BrN2O2
and a molecular weight of 303.20 g/mol. Its IUPAC name is 4-amino-5-[1-(aminomethyl)cyclopentyl]benzene-1,2-diol;hydrobromide.
Molecular Properties
| Compound Name | 4-amino-5-[1-(aminomethyl)cyclopentyl]benzene-1,2-diol;hydrobromide |
| PubChem CID | 90678002 |
| Molecular Formula | C12H19BrN2O2 |
| Molecular Weight | 303.20 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | 4-amino-5-[1-(aminomethyl)cyclopentyl]benzene-1,2-diol;hydrobromide |
| SMILES | Br.NCC1(c2cc(O)c(O)cc2N)CCCC1 |
| InChI | InChI=1S/C12H18N2O2.BrH/c13-7-12(3-1-2-4-12)8-5-10(15)11(16)6-9(8)14;/h5-6,15-16H,1-4,7,13-14H2;1H |
| InChIKey | GNKIGAUBOKXOGO-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.20 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-5-[1-(aminomethyl)cyclopentyl]benzene-1,2-diol;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-5-[1-(aminomethyl)cyclopentyl]benzene-1,2-diol;hydrobromide?
The IUPAC name of 4-amino-5-[1-(aminomethyl)cyclopentyl]benzene-1,2-diol;hydrobromide (CID 90678002) is 4-amino-5-[1-(aminomethyl)cyclopentyl]benzene-1,2-diol;hydrobromide.
What is the SMILES notation for 4-amino-5-[1-(aminomethyl)cyclopentyl]benzene-1,2-diol;hydrobromide?
The canonical SMILES for 4-amino-5-[1-(aminomethyl)cyclopentyl]benzene-1,2-diol;hydrobromide is Br.NCC1(c2cc(O)c(O)cc2N)CCCC1.
What is the InChIKey of 4-amino-5-[1-(aminomethyl)cyclopentyl]benzene-1,2-diol;hydrobromide?
The InChIKey is GNKIGAUBOKXOGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2O2.BrH/c13-7-12(3-1-2-4-12)8-5-10(15)11(16)6-9(8)14;/h5-6,15-16H,1-4,7,13-14H2;1H.
What are the key properties of 4-amino-5-[1-(aminomethyl)cyclopentyl]benzene-1,2-diol;hydrobromide?
4-amino-5-[1-(aminomethyl)cyclopentyl]benzene-1,2-diol;hydrobromide has a molecular weight of 303.20 g/mol, XLogP of 2.03, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-5-[1-(aminomethyl)cyclopentyl]benzene-1,2-diol;hydrobromide is sourced from PubChem (CID 90678002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).