About 4-amino-5-[2-(dimethylamino)ethyl]benzene-1,2-diol;dihydrobromide
4-amino-5-[2-(dimethylamino)ethyl]benzene-1,2-diol;dihydrobromide (PubChem CID 90678004) has the molecular formula C10H18Br2N2O2
and a molecular weight of 358.07 g/mol. Its IUPAC name is 4-amino-5-[2-(dimethylamino)ethyl]benzene-1,2-diol;dihydrobromide.
Molecular Properties
| Compound Name | 4-amino-5-[2-(dimethylamino)ethyl]benzene-1,2-diol;dihydrobromide |
| PubChem CID | 90678004 |
| Molecular Formula | C10H18Br2N2O2 |
| Molecular Weight | 358.07 g/mol |
| Exact Mass | 355.97 |
| IUPAC Name | 4-amino-5-[2-(dimethylamino)ethyl]benzene-1,2-diol;dihydrobromide |
| SMILES | Br.Br.CN(C)CCc1cc(O)c(O)cc1N |
| InChI | InChI=1S/C10H16N2O2.2BrH/c1-12(2)4-3-7-5-9(13)10(14)6-8(7)11;;/h5-6,13-14H,3-4,11H2,1-2H3;2*1H |
| InChIKey | NFSUCOXLQUJTOK-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.07 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-5-[2-(dimethylamino)ethyl]benzene-1,2-diol;dihydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-5-[2-(dimethylamino)ethyl]benzene-1,2-diol;dihydrobromide?
The IUPAC name of 4-amino-5-[2-(dimethylamino)ethyl]benzene-1,2-diol;dihydrobromide (CID 90678004) is 4-amino-5-[2-(dimethylamino)ethyl]benzene-1,2-diol;dihydrobromide.
What is the SMILES notation for 4-amino-5-[2-(dimethylamino)ethyl]benzene-1,2-diol;dihydrobromide?
The canonical SMILES for 4-amino-5-[2-(dimethylamino)ethyl]benzene-1,2-diol;dihydrobromide is Br.Br.CN(C)CCc1cc(O)c(O)cc1N.
What is the InChIKey of 4-amino-5-[2-(dimethylamino)ethyl]benzene-1,2-diol;dihydrobromide?
The InChIKey is NFSUCOXLQUJTOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O2.2BrH/c1-12(2)4-3-7-5-9(13)10(14)6-8(7)11;;/h5-6,13-14H,3-4,11H2,1-2H3;2*1H.
What are the key properties of 4-amino-5-[2-(dimethylamino)ethyl]benzene-1,2-diol;dihydrobromide?
4-amino-5-[2-(dimethylamino)ethyl]benzene-1,2-diol;dihydrobromide has a molecular weight of 358.07 g/mol, XLogP of 1.94, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-5-[2-(dimethylamino)ethyl]benzene-1,2-diol;dihydrobromide is sourced from PubChem (CID 90678004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).