About 2-(2-amino-4,5-dihydroxyphenyl)ethyl-trimethylazanium;bromide;hydrobromide
2-(2-amino-4,5-dihydroxyphenyl)ethyl-trimethylazanium;bromide;hydrobromide (PubChem CID 90678005) has the molecular formula C11H20Br2N2O2
and a molecular weight of 372.10 g/mol. Its IUPAC name is 2-(2-amino-4,5-dihydroxyphenyl)ethyl-trimethylazanium;bromide;hydrobromide.
Molecular Properties
| Compound Name | 2-(2-amino-4,5-dihydroxyphenyl)ethyl-trimethylazanium;bromide;hydrobromide |
| PubChem CID | 90678005 |
| Molecular Formula | C11H20Br2N2O2 |
| Molecular Weight | 372.10 g/mol |
| Exact Mass | 369.99 |
| IUPAC Name | 2-(2-amino-4,5-dihydroxyphenyl)ethyl-trimethylazanium;bromide;hydrobromide |
| SMILES | Br.C[N+](C)(C)CCc1cc(O)c(O)cc1N.[Br-] |
| InChI | InChI=1S/C11H18N2O2.2BrH/c1-13(2,3)5-4-8-6-10(14)11(15)7-9(8)12;;/h6-7H,4-5,12H2,1-3H3,(H-,14,15);2*1H |
| InChIKey | CBGUEOFGRWFLRB-UHFFFAOYSA-N |
| XLogP | -1.49 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.10 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-amino-4,5-dihydroxyphenyl)ethyl-trimethylazanium;bromide;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-amino-4,5-dihydroxyphenyl)ethyl-trimethylazanium;bromide;hydrobromide?
The IUPAC name of 2-(2-amino-4,5-dihydroxyphenyl)ethyl-trimethylazanium;bromide;hydrobromide (CID 90678005) is 2-(2-amino-4,5-dihydroxyphenyl)ethyl-trimethylazanium;bromide;hydrobromide.
What is the SMILES notation for 2-(2-amino-4,5-dihydroxyphenyl)ethyl-trimethylazanium;bromide;hydrobromide?
The canonical SMILES for 2-(2-amino-4,5-dihydroxyphenyl)ethyl-trimethylazanium;bromide;hydrobromide is Br.C[N+](C)(C)CCc1cc(O)c(O)cc1N.[Br-].
What is the InChIKey of 2-(2-amino-4,5-dihydroxyphenyl)ethyl-trimethylazanium;bromide;hydrobromide?
The InChIKey is CBGUEOFGRWFLRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O2.2BrH/c1-13(2,3)5-4-8-6-10(14)11(15)7-9(8)12;;/h6-7H,4-5,12H2,1-3H3,(H-,14,15);2*1H.
What are the key properties of 2-(2-amino-4,5-dihydroxyphenyl)ethyl-trimethylazanium;bromide;hydrobromide?
2-(2-amino-4,5-dihydroxyphenyl)ethyl-trimethylazanium;bromide;hydrobromide has a molecular weight of 372.10 g/mol, XLogP of -1.49, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-amino-4,5-dihydroxyphenyl)ethyl-trimethylazanium;bromide;hydrobromide is sourced from PubChem (CID 90678005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).