C17H20N2O2S2 — CID 90678125
2,2,11-trimethyl-15-propan-2-yl-12,13-dithia-9,15-diazatetracyclo[9.2.2.01,9.03,8]pentadeca-3,5,7-triene-10,14-dione (PubChem CID 90678125) has the molecular formula C17H20N2O2S2 and a molecular weight of 348.49 g/mol. Its IUPAC name is 2,2,11-trimethyl-15-propan-2-yl-12,13-dithia-9,15-diazatetracyclo[9.2.2.01,9.03,8]pentadeca-3,5,7-triene-10,14-dione.
| Compound Name | 2,2,11-trimethyl-15-propan-2-yl-12,13-dithia-9,15-diazatetracyclo[9.2.2.01,9.03,8]pentadeca-3,5,7-triene-10,14-dione |
|---|---|
| PubChem CID | 90678125 |
| Molecular Formula | C17H20N2O2S2 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | 2,2,11-trimethyl-15-propan-2-yl-12,13-dithia-9,15-diazatetracyclo[9.2.2.01,9.03,8]pentadeca-3,5,7-triene-10,14-dione |
| SMILES | CC(C)N1C(=O)C23SSC1(C)C(=O)N2c1ccccc1C3(C)C |
| InChI | InChI=1S/C17H20N2O2S2/c1-10(2)18-14(21)17-15(3,4)11-8-6-7-9-12(11)19(17)13(20)16(18,5)22-23-17/h6-10H,1-5H3 |
| InChIKey | FDQOBPGLMOWYTD-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|