C16H18N2O2S2 — CID 90678126
15-ethyl-2,2,11-trimethyl-12,13-dithia-9,15-diazatetracyclo[9.2.2.01,9.03,8]pentadeca-3,5,7-triene-10,14-dione (PubChem CID 90678126) has the molecular formula C16H18N2O2S2 and a molecular weight of 334.47 g/mol. Its IUPAC name is 15-ethyl-2,2,11-trimethyl-12,13-dithia-9,15-diazatetracyclo[9.2.2.01,9.03,8]pentadeca-3,5,7-triene-10,14-dione.
| Compound Name | 15-ethyl-2,2,11-trimethyl-12,13-dithia-9,15-diazatetracyclo[9.2.2.01,9.03,8]pentadeca-3,5,7-triene-10,14-dione |
|---|---|
| PubChem CID | 90678126 |
| Molecular Formula | C16H18N2O2S2 |
| Molecular Weight | 334.47 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | 15-ethyl-2,2,11-trimethyl-12,13-dithia-9,15-diazatetracyclo[9.2.2.01,9.03,8]pentadeca-3,5,7-triene-10,14-dione |
| SMILES | CCN1C(=O)C23SSC1(C)C(=O)N2c1ccccc1C3(C)C |
| InChI | InChI=1S/C16H18N2O2S2/c1-5-17-13(20)16-14(2,3)10-8-6-7-9-11(10)18(16)12(19)15(17,4)21-22-16/h6-9H,5H2,1-4H3 |
| InChIKey | BRWNXIBYRFUVHD-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.47 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|