About (2R)-2-amino-N-[(2R)-1-(hydroxyamino)-1-oxopropan-2-yl]propanamide;hydrobromide
(2R)-2-amino-N-[(2R)-1-(hydroxyamino)-1-oxopropan-2-yl]propanamide;hydrobromide (PubChem CID 90678147) has the molecular formula C6H14BrN3O3
and a molecular weight of 256.10 g/mol. Its IUPAC name is (2R)-2-amino-N-[(2R)-1-(hydroxyamino)-1-oxopropan-2-yl]propanamide;hydrobromide.
Molecular Properties
| Compound Name | (2R)-2-amino-N-[(2R)-1-(hydroxyamino)-1-oxopropan-2-yl]propanamide;hydrobromide |
| PubChem CID | 90678147 |
| Molecular Formula | C6H14BrN3O3 |
| Molecular Weight | 256.10 g/mol |
| Exact Mass | 255.02 |
| IUPAC Name | (2R)-2-amino-N-[(2R)-1-(hydroxyamino)-1-oxopropan-2-yl]propanamide;hydrobromide |
| SMILES | Br.C[C@@H](N)C(=O)N[C@H](C)C(=O)NO |
| InChI | InChI=1S/C6H13N3O3.BrH/c1-3(7)5(10)8-4(2)6(11)9-12;/h3-4,12H,7H2,1-2H3,(H,8,10)(H,9,11);1H/t3-,4-;/m1./s1 |
| InChIKey | WERQCEPIPWOIKV-VKKIDBQXSA-N |
| XLogP | -1.08 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.10 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-amino-N-[(2R)-1-(hydroxyamino)-1-oxopropan-2-yl]propanamide;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-amino-N-[(2R)-1-(hydroxyamino)-1-oxopropan-2-yl]propanamide;hydrobromide?
The IUPAC name of (2R)-2-amino-N-[(2R)-1-(hydroxyamino)-1-oxopropan-2-yl]propanamide;hydrobromide (CID 90678147) is (2R)-2-amino-N-[(2R)-1-(hydroxyamino)-1-oxopropan-2-yl]propanamide;hydrobromide.
What is the SMILES notation for (2R)-2-amino-N-[(2R)-1-(hydroxyamino)-1-oxopropan-2-yl]propanamide;hydrobromide?
The canonical SMILES for (2R)-2-amino-N-[(2R)-1-(hydroxyamino)-1-oxopropan-2-yl]propanamide;hydrobromide is Br.C[C@@H](N)C(=O)N[C@H](C)C(=O)NO.
What is the InChIKey of (2R)-2-amino-N-[(2R)-1-(hydroxyamino)-1-oxopropan-2-yl]propanamide;hydrobromide?
The InChIKey is WERQCEPIPWOIKV-VKKIDBQXSA-N. The full InChI is InChI=1S/C6H13N3O3.BrH/c1-3(7)5(10)8-4(2)6(11)9-12;/h3-4,12H,7H2,1-2H3,(H,8,10)(H,9,11);1H/t3-,4-;/m1./s1.
What are the key properties of (2R)-2-amino-N-[(2R)-1-(hydroxyamino)-1-oxopropan-2-yl]propanamide;hydrobromide?
(2R)-2-amino-N-[(2R)-1-(hydroxyamino)-1-oxopropan-2-yl]propanamide;hydrobromide has a molecular weight of 256.10 g/mol, XLogP of -1.08, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-amino-N-[(2R)-1-(hydroxyamino)-1-oxopropan-2-yl]propanamide;hydrobromide is sourced from PubChem (CID 90678147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).