C19H29NO — CID 90678175
(2R,3R,4aS,8aS)-2-phenyl-3-(propan-2-ylamino)-3,4,4a,5,6,7,8,8a-octahydro-1H-naphthalen-2-ol (PubChem CID 90678175) has the molecular formula C19H29NO and a molecular weight of 287.45 g/mol. Its IUPAC name is (2R,3R,4aS,8aS)-2-phenyl-3-(propan-2-ylamino)-3,4,4a,5,6,7,8,8a-octahydro-1H-naphthalen-2-ol.
| Compound Name | (2R,3R,4aS,8aS)-2-phenyl-3-(propan-2-ylamino)-3,4,4a,5,6,7,8,8a-octahydro-1H-naphthalen-2-ol |
|---|---|
| PubChem CID | 90678175 |
| Molecular Formula | C19H29NO |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.22 |
| IUPAC Name | (2R,3R,4aS,8aS)-2-phenyl-3-(propan-2-ylamino)-3,4,4a,5,6,7,8,8a-octahydro-1H-naphthalen-2-ol |
| SMILES | CC(C)N[C@@H]1C[C@@H]2CCCC[C@H]2C[C@@]1(O)c1ccccc1 |
| InChI | InChI=1S/C19H29NO/c1-14(2)20-18-12-15-8-6-7-9-16(15)13-19(18,21)17-10-4-3-5-11-17/h3-5,10-11,14-16,18,20-21H,6-9,12-13H2,1-2H3/t15-,16-,18+,19+/m0/s1 |
| InChIKey | LIAYKOWSPMCNGJ-RNIPGJKVSA-N |
| XLogP | 3.84 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |