About bis[(3-methylpiperidin-1-yl)methyl] dibenzofuran-2,8-dicarboxylate
bis[(3-methylpiperidin-1-yl)methyl] dibenzofuran-2,8-dicarboxylate (PubChem CID 90678268) has the molecular formula C28H34N2O5
and a molecular weight of 478.59 g/mol. Its IUPAC name is bis[(3-methylpiperidin-1-yl)methyl] dibenzofuran-2,8-dicarboxylate.
Molecular Properties
| Compound Name | bis[(3-methylpiperidin-1-yl)methyl] dibenzofuran-2,8-dicarboxylate |
| PubChem CID | 90678268 |
| Molecular Formula | C28H34N2O5 |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.25 |
| IUPAC Name | bis[(3-methylpiperidin-1-yl)methyl] dibenzofuran-2,8-dicarboxylate |
| SMILES | CC1CCCN(COC(=O)c2ccc3oc4ccc(C(=O)OCN5CCCC(C)C5)cc4c3c2)C1 |
| InChI | InChI=1S/C28H34N2O5/c1-19-5-3-11-29(15-19)17-33-27(31)21-7-9-25-23(13-21)24-14-22(8-10-26(24)35-25)28(32)34-18-30-12-4-6-20(2)16-30/h7-10,13-14,19-20H,3-6,11-12,15-18H2,1-2H3 |
| InChIKey | WVRJXUCCOITWLU-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 72.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze bis[(3-methylpiperidin-1-yl)methyl] dibenzofuran-2,8-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[(3-methylpiperidin-1-yl)methyl] dibenzofuran-2,8-dicarboxylate?
The IUPAC name of bis[(3-methylpiperidin-1-yl)methyl] dibenzofuran-2,8-dicarboxylate (CID 90678268) is bis[(3-methylpiperidin-1-yl)methyl] dibenzofuran-2,8-dicarboxylate.
What is the SMILES notation for bis[(3-methylpiperidin-1-yl)methyl] dibenzofuran-2,8-dicarboxylate?
The canonical SMILES for bis[(3-methylpiperidin-1-yl)methyl] dibenzofuran-2,8-dicarboxylate is CC1CCCN(COC(=O)c2ccc3oc4ccc(C(=O)OCN5CCCC(C)C5)cc4c3c2)C1.
What is the InChIKey of bis[(3-methylpiperidin-1-yl)methyl] dibenzofuran-2,8-dicarboxylate?
The InChIKey is WVRJXUCCOITWLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H34N2O5/c1-19-5-3-11-29(15-19)17-33-27(31)21-7-9-25-23(13-21)24-14-22(8-10-26(24)35-25)28(32)34-18-30-12-4-6-20(2)16-30/h7-10,13-14,19-20H,3-6,11-12,15-18H2,1-2H3.
What are the key properties of bis[(3-methylpiperidin-1-yl)methyl] dibenzofuran-2,8-dicarboxylate?
bis[(3-methylpiperidin-1-yl)methyl] dibenzofuran-2,8-dicarboxylate has a molecular weight of 478.59 g/mol, XLogP of 5.28, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for bis[(3-methylpiperidin-1-yl)methyl] dibenzofuran-2,8-dicarboxylate is sourced from PubChem (CID 90678268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).