C18H26ClN5 — CID 90678432
N-(1,3-dimethylpyrazolo[3,4-b]quinolin-4-yl)-N',N'-dimethylbutane-1,4-diamine;hydrochloride (PubChem CID 90678432) has the molecular formula C18H26ClN5 and a molecular weight of 347.89 g/mol. Its IUPAC name is N-(1,3-dimethylpyrazolo[3,4-b]quinolin-4-yl)-N',N'-dimethylbutane-1,4-diamine;hydrochloride.
| Compound Name | N-(1,3-dimethylpyrazolo[3,4-b]quinolin-4-yl)-N',N'-dimethylbutane-1,4-diamine;hydrochloride |
|---|---|
| PubChem CID | 90678432 |
| Molecular Formula | C18H26ClN5 |
| Molecular Weight | 347.89 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | N-(1,3-dimethylpyrazolo[3,4-b]quinolin-4-yl)-N',N'-dimethylbutane-1,4-diamine;hydrochloride |
| SMILES | Cc1nn(C)c2nc3ccccc3c(NCCCCN(C)C)c12.Cl |
| InChI | InChI=1S/C18H25N5.ClH/c1-13-16-17(19-11-7-8-12-22(2)3)14-9-5-6-10-15(14)20-18(16)23(4)21-13;/h5-6,9-10H,7-8,11-12H2,1-4H3,(H,19,20);1H |
| InChIKey | WOXYXEPVUMZRFZ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.89 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|