About 1,3-dimethyl-N-(3-methylsulfanylpropyl)pyrazolo[3,4-b]quinolin-4-amine
1,3-dimethyl-N-(3-methylsulfanylpropyl)pyrazolo[3,4-b]quinolin-4-amine (PubChem CID 90678436) has the molecular formula C16H20N4S
and a molecular weight of 300.43 g/mol. Its IUPAC name is 1,3-dimethyl-N-(3-methylsulfanylpropyl)pyrazolo[3,4-b]quinolin-4-amine.
Molecular Properties
| Compound Name | 1,3-dimethyl-N-(3-methylsulfanylpropyl)pyrazolo[3,4-b]quinolin-4-amine |
| PubChem CID | 90678436 |
| Molecular Formula | C16H20N4S |
| Molecular Weight | 300.43 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 1,3-dimethyl-N-(3-methylsulfanylpropyl)pyrazolo[3,4-b]quinolin-4-amine |
| SMILES | CSCCCNc1c2ccccc2nc2c1c(C)nn2C |
| InChI | InChI=1S/C16H20N4S/c1-11-14-15(17-9-6-10-21-3)12-7-4-5-8-13(12)18-16(14)20(2)19-11/h4-5,7-8H,6,9-10H2,1-3H3,(H,17,18) |
| InChIKey | BYIKULQBOBODSC-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.43 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dimethyl-N-(3-methylsulfanylpropyl)pyrazolo[3,4-b]quinolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethyl-N-(3-methylsulfanylpropyl)pyrazolo[3,4-b]quinolin-4-amine?
The IUPAC name of 1,3-dimethyl-N-(3-methylsulfanylpropyl)pyrazolo[3,4-b]quinolin-4-amine (CID 90678436) is 1,3-dimethyl-N-(3-methylsulfanylpropyl)pyrazolo[3,4-b]quinolin-4-amine.
What is the SMILES notation for 1,3-dimethyl-N-(3-methylsulfanylpropyl)pyrazolo[3,4-b]quinolin-4-amine?
The canonical SMILES for 1,3-dimethyl-N-(3-methylsulfanylpropyl)pyrazolo[3,4-b]quinolin-4-amine is CSCCCNc1c2ccccc2nc2c1c(C)nn2C.
What is the InChIKey of 1,3-dimethyl-N-(3-methylsulfanylpropyl)pyrazolo[3,4-b]quinolin-4-amine?
The InChIKey is BYIKULQBOBODSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N4S/c1-11-14-15(17-9-6-10-21-3)12-7-4-5-8-13(12)18-16(14)20(2)19-11/h4-5,7-8H,6,9-10H2,1-3H3,(H,17,18).
What are the key properties of 1,3-dimethyl-N-(3-methylsulfanylpropyl)pyrazolo[3,4-b]quinolin-4-amine?
1,3-dimethyl-N-(3-methylsulfanylpropyl)pyrazolo[3,4-b]quinolin-4-amine has a molecular weight of 300.43 g/mol, XLogP of 3.59, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethyl-N-(3-methylsulfanylpropyl)pyrazolo[3,4-b]quinolin-4-amine is sourced from PubChem (CID 90678436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).