C22H36O6 — CID 90678569
(Z)-7-[(7R,8R,9R)-7-hydroxy-8-[(E,3S)-3-hydroxyoct-1-enyl]-1,4-dioxaspiro[4.4]nonan-9-yl]hept-5-enoic acid (PubChem CID 90678569) has the molecular formula C22H36O6 and a molecular weight of 396.52 g/mol. Its IUPAC name is (Z)-7-[(7R,8R,9R)-7-hydroxy-8-[(E,3S)-3-hydroxyoct-1-enyl]-1,4-dioxaspiro[4.4]nonan-9-yl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(7R,8R,9R)-7-hydroxy-8-[(E,3S)-3-hydroxyoct-1-enyl]-1,4-dioxaspiro[4.4]nonan-9-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 90678569 |
| Molecular Formula | C22H36O6 |
| Molecular Weight | 396.52 g/mol |
| Exact Mass | 396.25 |
| IUPAC Name | (Z)-7-[(7R,8R,9R)-7-hydroxy-8-[(E,3S)-3-hydroxyoct-1-enyl]-1,4-dioxaspiro[4.4]nonan-9-yl]hept-5-enoic acid |
| SMILES | CCCCC[C@H](O)/C=C/[C@H]1[C@H](O)CC2(OCCO2)[C@@H]1C/C=C\CCCC(=O)O |
| InChI | InChI=1S/C22H36O6/c1-2-3-6-9-17(23)12-13-18-19(10-7-4-5-8-11-21(25)26)22(16-20(18)24)27-14-15-28-22/h4,7,12-13,17-20,23-24H,2-3,5-6,8-11,14-16H2,1H3,(H,25,26)/b7-4-,13-12+/t17-,18+,19+,20+/m0/s1 |
| InChIKey | FIVWGSPFTAEYLL-HQJRPSFQSA-N |
| XLogP | 3.43 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.52 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|