About 6-[2-(3,4-dichlorophenyl)hydrazinyl]-1H-pyrimidine-2,4-dione
6-[2-(3,4-dichlorophenyl)hydrazinyl]-1H-pyrimidine-2,4-dione (PubChem CID 90678614) has the molecular formula C10H8Cl2N4O2
and a molecular weight of 287.11 g/mol. Its IUPAC name is 6-[2-(3,4-dichlorophenyl)hydrazinyl]-1H-pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 6-[2-(3,4-dichlorophenyl)hydrazinyl]-1H-pyrimidine-2,4-dione |
| PubChem CID | 90678614 |
| Molecular Formula | C10H8Cl2N4O2 |
| Molecular Weight | 287.11 g/mol |
| Exact Mass | 286.00 |
| IUPAC Name | 6-[2-(3,4-dichlorophenyl)hydrazinyl]-1H-pyrimidine-2,4-dione |
| SMILES | O=c1cc(NNc2ccc(Cl)c(Cl)c2)[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C10H8Cl2N4O2/c11-6-2-1-5(3-7(6)12)15-16-8-4-9(17)14-10(18)13-8/h1-4,15H,(H3,13,14,16,17,18) |
| InChIKey | MBEDZJDDZHCURA-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 89.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.11 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-[2-(3,4-dichlorophenyl)hydrazinyl]-1H-pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[2-(3,4-dichlorophenyl)hydrazinyl]-1H-pyrimidine-2,4-dione?
The IUPAC name of 6-[2-(3,4-dichlorophenyl)hydrazinyl]-1H-pyrimidine-2,4-dione (CID 90678614) is 6-[2-(3,4-dichlorophenyl)hydrazinyl]-1H-pyrimidine-2,4-dione.
What is the SMILES notation for 6-[2-(3,4-dichlorophenyl)hydrazinyl]-1H-pyrimidine-2,4-dione?
The canonical SMILES for 6-[2-(3,4-dichlorophenyl)hydrazinyl]-1H-pyrimidine-2,4-dione is O=c1cc(NNc2ccc(Cl)c(Cl)c2)[nH]c(=O)[nH]1.
What is the InChIKey of 6-[2-(3,4-dichlorophenyl)hydrazinyl]-1H-pyrimidine-2,4-dione?
The InChIKey is MBEDZJDDZHCURA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8Cl2N4O2/c11-6-2-1-5(3-7(6)12)15-16-8-4-9(17)14-10(18)13-8/h1-4,15H,(H3,13,14,16,17,18).
What are the key properties of 6-[2-(3,4-dichlorophenyl)hydrazinyl]-1H-pyrimidine-2,4-dione?
6-[2-(3,4-dichlorophenyl)hydrazinyl]-1H-pyrimidine-2,4-dione has a molecular weight of 287.11 g/mol, XLogP of 1.81, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[2-(3,4-dichlorophenyl)hydrazinyl]-1H-pyrimidine-2,4-dione is sourced from PubChem (CID 90678614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).