C13H21N5 — CID 90678705
N-(1,3-dimethylpyrazolo[3,4-b]pyridin-4-yl)-N',N'-dimethylpropane-1,3-diamine (PubChem CID 90678705) has the molecular formula C13H21N5 and a molecular weight of 247.35 g/mol. Its IUPAC name is N-(1,3-dimethylpyrazolo[3,4-b]pyridin-4-yl)-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-(1,3-dimethylpyrazolo[3,4-b]pyridin-4-yl)-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 90678705 |
| Molecular Formula | C13H21N5 |
| Molecular Weight | 247.35 g/mol |
| Exact Mass | 247.18 |
| IUPAC Name | N-(1,3-dimethylpyrazolo[3,4-b]pyridin-4-yl)-N',N'-dimethylpropane-1,3-diamine |
| SMILES | Cc1nn(C)c2nccc(NCCCN(C)C)c12 |
| InChI | InChI=1S/C13H21N5/c1-10-12-11(14-7-5-9-17(2)3)6-8-15-13(12)18(4)16-10/h6,8H,5,7,9H2,1-4H3,(H,14,15) |
| InChIKey | DBOZOHVRTGKVQD-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.35 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|