About 5-(2-methylsulfanylethyl)-(411C)1,3-diazolidine-2,4-dione
5-(2-methylsulfanylethyl)-(411C)1,3-diazolidine-2,4-dione (PubChem CID 90678709) has the molecular formula C6H10N2O2S
and a molecular weight of 173.23 g/mol. Its IUPAC name is 5-(2-methylsulfanylethyl)-(411C)1,3-diazolidine-2,4-dione.
Molecular Properties
| Compound Name | 5-(2-methylsulfanylethyl)-(411C)1,3-diazolidine-2,4-dione |
| PubChem CID | 90678709 |
| Molecular Formula | C6H10N2O2S |
| Molecular Weight | 173.23 g/mol |
| Exact Mass | 173.06 |
| IUPAC Name | 5-(2-methylsulfanylethyl)-(411C)1,3-diazolidine-2,4-dione |
| SMILES | CSCCC1NC(=O)N[11C]1=O |
| InChI | InChI=1S/C6H10N2O2S/c1-11-3-2-4-5(9)8-6(10)7-4/h4H,2-3H2,1H3,(H2,7,8,9,10)/i5-1 |
| InChIKey | SBKRXUMXMKBCLD-SFIIULIVSA-N |
| XLogP | -0.05 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.23 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze 5-(2-methylsulfanylethyl)-(411C)1,3-diazolidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-methylsulfanylethyl)-(411C)1,3-diazolidine-2,4-dione?
The IUPAC name of 5-(2-methylsulfanylethyl)-(411C)1,3-diazolidine-2,4-dione (CID 90678709) is 5-(2-methylsulfanylethyl)-(411C)1,3-diazolidine-2,4-dione.
What is the SMILES notation for 5-(2-methylsulfanylethyl)-(411C)1,3-diazolidine-2,4-dione?
The canonical SMILES for 5-(2-methylsulfanylethyl)-(411C)1,3-diazolidine-2,4-dione is CSCCC1NC(=O)N[11C]1=O.
What is the InChIKey of 5-(2-methylsulfanylethyl)-(411C)1,3-diazolidine-2,4-dione?
The InChIKey is SBKRXUMXMKBCLD-SFIIULIVSA-N. The full InChI is InChI=1S/C6H10N2O2S/c1-11-3-2-4-5(9)8-6(10)7-4/h4H,2-3H2,1H3,(H2,7,8,9,10)/i5-1.
What are the key properties of 5-(2-methylsulfanylethyl)-(411C)1,3-diazolidine-2,4-dione?
5-(2-methylsulfanylethyl)-(411C)1,3-diazolidine-2,4-dione has a molecular weight of 173.23 g/mol, XLogP of -0.05, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-methylsulfanylethyl)-(411C)1,3-diazolidine-2,4-dione is sourced from PubChem (CID 90678709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).