About ethyl 4-[4-(1-methylimidazol-2-yl)sulfanylbutoxy]benzoate;hydrobromide
ethyl 4-[4-(1-methylimidazol-2-yl)sulfanylbutoxy]benzoate;hydrobromide (PubChem CID 90678790) has the molecular formula C17H23BrN2O3S
and a molecular weight of 415.35 g/mol. Its IUPAC name is ethyl 4-[4-(1-methylimidazol-2-yl)sulfanylbutoxy]benzoate;hydrobromide.
Molecular Properties
| Compound Name | ethyl 4-[4-(1-methylimidazol-2-yl)sulfanylbutoxy]benzoate;hydrobromide |
| PubChem CID | 90678790 |
| Molecular Formula | C17H23BrN2O3S |
| Molecular Weight | 415.35 g/mol |
| Exact Mass | 414.06 |
| IUPAC Name | ethyl 4-[4-(1-methylimidazol-2-yl)sulfanylbutoxy]benzoate;hydrobromide |
| SMILES | Br.CCOC(=O)c1ccc(OCCCCSc2nccn2C)cc1 |
| InChI | InChI=1S/C17H22N2O3S.BrH/c1-3-21-16(20)14-6-8-15(9-7-14)22-12-4-5-13-23-17-18-10-11-19(17)2;/h6-11H,3-5,12-13H2,1-2H3;1H |
| InChIKey | RVGRIXSJNMFJAJ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.35 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-[4-(1-methylimidazol-2-yl)sulfanylbutoxy]benzoate;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[4-(1-methylimidazol-2-yl)sulfanylbutoxy]benzoate;hydrobromide?
The IUPAC name of ethyl 4-[4-(1-methylimidazol-2-yl)sulfanylbutoxy]benzoate;hydrobromide (CID 90678790) is ethyl 4-[4-(1-methylimidazol-2-yl)sulfanylbutoxy]benzoate;hydrobromide.
What is the SMILES notation for ethyl 4-[4-(1-methylimidazol-2-yl)sulfanylbutoxy]benzoate;hydrobromide?
The canonical SMILES for ethyl 4-[4-(1-methylimidazol-2-yl)sulfanylbutoxy]benzoate;hydrobromide is Br.CCOC(=O)c1ccc(OCCCCSc2nccn2C)cc1.
What is the InChIKey of ethyl 4-[4-(1-methylimidazol-2-yl)sulfanylbutoxy]benzoate;hydrobromide?
The InChIKey is RVGRIXSJNMFJAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N2O3S.BrH/c1-3-21-16(20)14-6-8-15(9-7-14)22-12-4-5-13-23-17-18-10-11-19(17)2;/h6-11H,3-5,12-13H2,1-2H3;1H.
What are the key properties of ethyl 4-[4-(1-methylimidazol-2-yl)sulfanylbutoxy]benzoate;hydrobromide?
ethyl 4-[4-(1-methylimidazol-2-yl)sulfanylbutoxy]benzoate;hydrobromide has a molecular weight of 415.35 g/mol, XLogP of 4.13, 9 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[4-(1-methylimidazol-2-yl)sulfanylbutoxy]benzoate;hydrobromide is sourced from PubChem (CID 90678790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).