C18H25Br2N3O3 — CID 90678997
3-[[1-[(4-bromophenyl)methyl]-3-methylimidazol-1-ium-4-yl]methyl]-2-ethyl-N,4-dihydroxybutanamide bromide (PubChem CID 90678997) has the molecular formula C18H25Br2N3O3 and a molecular weight of 491.22 g/mol. Its IUPAC name is 3-[[1-[(4-bromophenyl)methyl]-3-methylimidazol-1-ium-4-yl]methyl]-2-ethyl-N,4-dihydroxybutanamide bromide.
| Compound Name | 3-[[1-[(4-bromophenyl)methyl]-3-methylimidazol-1-ium-4-yl]methyl]-2-ethyl-N,4-dihydroxybutanamide bromide |
|---|---|
| PubChem CID | 90678997 |
| Molecular Formula | C18H25Br2N3O3 |
| Molecular Weight | 491.22 g/mol |
| Exact Mass | 489.03 |
| IUPAC Name | 3-[[1-[(4-bromophenyl)methyl]-3-methylimidazol-1-ium-4-yl]methyl]-2-ethyl-N,4-dihydroxybutanamide bromide |
| SMILES | CCC(C(=O)NO)C(CO)Cc1c[n+](Cc2ccc(Br)cc2)cn1C.[Br-] |
| InChI | InChI=1S/C18H24BrN3O3.BrH/c1-3-17(18(24)20-25)14(11-23)8-16-10-22(12-21(16)2)9-13-4-6-15(19)7-5-13;/h4-7,10,12,14,17,23H,3,8-9,11H2,1-2H3,(H-,20,24,25);1H |
| InChIKey | WKLDATGIRXRCAS-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 78.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.22 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|