About (E)-4-cyclohexylidene-2,3-diphenyl-1-pyrrolidin-1-ylbut-2-en-1-one
(E)-4-cyclohexylidene-2,3-diphenyl-1-pyrrolidin-1-ylbut-2-en-1-one (PubChem CID 90679217) has the molecular formula C26H29NO
and a molecular weight of 371.52 g/mol. Its IUPAC name is (E)-4-cyclohexylidene-2,3-diphenyl-1-pyrrolidin-1-ylbut-2-en-1-one.
Molecular Properties
| Compound Name | (E)-4-cyclohexylidene-2,3-diphenyl-1-pyrrolidin-1-ylbut-2-en-1-one |
| PubChem CID | 90679217 |
| Molecular Formula | C26H29NO |
| Molecular Weight | 371.52 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | (E)-4-cyclohexylidene-2,3-diphenyl-1-pyrrolidin-1-ylbut-2-en-1-one |
| SMILES | O=C(/C(=C(\C=C1CCCCC1)c1ccccc1)c1ccccc1)N1CCCC1 |
| InChI | InChI=1S/C26H29NO/c28-26(27-18-10-11-19-27)25(23-16-8-3-9-17-23)24(22-14-6-2-7-15-22)20-21-12-4-1-5-13-21/h2-3,6-9,14-17,20H,1,4-5,10-13,18-19H2/b25-24+ |
| InChIKey | FESGMRKIOFCHCV-OCOZRVBESA-N |
| XLogP | 6.11 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 371.52 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze (E)-4-cyclohexylidene-2,3-diphenyl-1-pyrrolidin-1-ylbut-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4-cyclohexylidene-2,3-diphenyl-1-pyrrolidin-1-ylbut-2-en-1-one?
The IUPAC name of (E)-4-cyclohexylidene-2,3-diphenyl-1-pyrrolidin-1-ylbut-2-en-1-one (CID 90679217) is (E)-4-cyclohexylidene-2,3-diphenyl-1-pyrrolidin-1-ylbut-2-en-1-one.
What is the SMILES notation for (E)-4-cyclohexylidene-2,3-diphenyl-1-pyrrolidin-1-ylbut-2-en-1-one?
The canonical SMILES for (E)-4-cyclohexylidene-2,3-diphenyl-1-pyrrolidin-1-ylbut-2-en-1-one is O=C(/C(=C(\C=C1CCCCC1)c1ccccc1)c1ccccc1)N1CCCC1.
What is the InChIKey of (E)-4-cyclohexylidene-2,3-diphenyl-1-pyrrolidin-1-ylbut-2-en-1-one?
The InChIKey is FESGMRKIOFCHCV-OCOZRVBESA-N. The full InChI is InChI=1S/C26H29NO/c28-26(27-18-10-11-19-27)25(23-16-8-3-9-17-23)24(22-14-6-2-7-15-22)20-21-12-4-1-5-13-21/h2-3,6-9,14-17,20H,1,4-5,10-13,18-19H2/b25-24+.
What are the key properties of (E)-4-cyclohexylidene-2,3-diphenyl-1-pyrrolidin-1-ylbut-2-en-1-one?
(E)-4-cyclohexylidene-2,3-diphenyl-1-pyrrolidin-1-ylbut-2-en-1-one has a molecular weight of 371.52 g/mol, XLogP of 6.11, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-cyclohexylidene-2,3-diphenyl-1-pyrrolidin-1-ylbut-2-en-1-one is sourced from PubChem (CID 90679217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).