About ethenyl (2S)-2-amino-3-phenylpropanoate;hydrochloride
ethenyl (2S)-2-amino-3-phenylpropanoate;hydrochloride (PubChem CID 90679315) has the molecular formula C11H14ClNO2
and a molecular weight of 227.69 g/mol. Its IUPAC name is ethenyl (2S)-2-amino-3-phenylpropanoate;hydrochloride.
Molecular Properties
| Compound Name | ethenyl (2S)-2-amino-3-phenylpropanoate;hydrochloride |
| PubChem CID | 90679315 |
| Molecular Formula | C11H14ClNO2 |
| Molecular Weight | 227.69 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | ethenyl (2S)-2-amino-3-phenylpropanoate;hydrochloride |
| SMILES | C=COC(=O)[C@@H](N)Cc1ccccc1.Cl |
| InChI | InChI=1S/C11H13NO2.ClH/c1-2-14-11(13)10(12)8-9-6-4-3-5-7-9;/h2-7,10H,1,8,12H2;1H/t10-;/m0./s1 |
| InChIKey | VOUAHBWHUIMTCZ-PPHPATTJSA-N |
| XLogP | 1.66 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.69 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze ethenyl (2S)-2-amino-3-phenylpropanoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenyl (2S)-2-amino-3-phenylpropanoate;hydrochloride?
The IUPAC name of ethenyl (2S)-2-amino-3-phenylpropanoate;hydrochloride (CID 90679315) is ethenyl (2S)-2-amino-3-phenylpropanoate;hydrochloride.
What is the SMILES notation for ethenyl (2S)-2-amino-3-phenylpropanoate;hydrochloride?
The canonical SMILES for ethenyl (2S)-2-amino-3-phenylpropanoate;hydrochloride is C=COC(=O)[C@@H](N)Cc1ccccc1.Cl.
What is the InChIKey of ethenyl (2S)-2-amino-3-phenylpropanoate;hydrochloride?
The InChIKey is VOUAHBWHUIMTCZ-PPHPATTJSA-N. The full InChI is InChI=1S/C11H13NO2.ClH/c1-2-14-11(13)10(12)8-9-6-4-3-5-7-9;/h2-7,10H,1,8,12H2;1H/t10-;/m0./s1.
What are the key properties of ethenyl (2S)-2-amino-3-phenylpropanoate;hydrochloride?
ethenyl (2S)-2-amino-3-phenylpropanoate;hydrochloride has a molecular weight of 227.69 g/mol, XLogP of 1.66, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethenyl (2S)-2-amino-3-phenylpropanoate;hydrochloride is sourced from PubChem (CID 90679315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).