About cyanomethyl (2S)-2-amino-3-phenylpropanoate;hydrochloride
cyanomethyl (2S)-2-amino-3-phenylpropanoate;hydrochloride (PubChem CID 90679316) has the molecular formula C11H13ClN2O2
and a molecular weight of 240.69 g/mol. Its IUPAC name is cyanomethyl (2S)-2-amino-3-phenylpropanoate;hydrochloride.
Molecular Properties
| Compound Name | cyanomethyl (2S)-2-amino-3-phenylpropanoate;hydrochloride |
| PubChem CID | 90679316 |
| Molecular Formula | C11H13ClN2O2 |
| Molecular Weight | 240.69 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | cyanomethyl (2S)-2-amino-3-phenylpropanoate;hydrochloride |
| SMILES | Cl.N#CCOC(=O)[C@@H](N)Cc1ccccc1 |
| InChI | InChI=1S/C11H12N2O2.ClH/c12-6-7-15-11(14)10(13)8-9-4-2-1-3-5-9;/h1-5,10H,7-8,13H2;1H/t10-;/m0./s1 |
| InChIKey | VYCLTDLRWROAKZ-PPHPATTJSA-N |
| XLogP | 1.04 |
| TPSA | 76.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.69 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze cyanomethyl (2S)-2-amino-3-phenylpropanoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyanomethyl (2S)-2-amino-3-phenylpropanoate;hydrochloride?
The IUPAC name of cyanomethyl (2S)-2-amino-3-phenylpropanoate;hydrochloride (CID 90679316) is cyanomethyl (2S)-2-amino-3-phenylpropanoate;hydrochloride.
What is the SMILES notation for cyanomethyl (2S)-2-amino-3-phenylpropanoate;hydrochloride?
The canonical SMILES for cyanomethyl (2S)-2-amino-3-phenylpropanoate;hydrochloride is Cl.N#CCOC(=O)[C@@H](N)Cc1ccccc1.
What is the InChIKey of cyanomethyl (2S)-2-amino-3-phenylpropanoate;hydrochloride?
The InChIKey is VYCLTDLRWROAKZ-PPHPATTJSA-N. The full InChI is InChI=1S/C11H12N2O2.ClH/c12-6-7-15-11(14)10(13)8-9-4-2-1-3-5-9;/h1-5,10H,7-8,13H2;1H/t10-;/m0./s1.
What are the key properties of cyanomethyl (2S)-2-amino-3-phenylpropanoate;hydrochloride?
cyanomethyl (2S)-2-amino-3-phenylpropanoate;hydrochloride has a molecular weight of 240.69 g/mol, XLogP of 1.04, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyanomethyl (2S)-2-amino-3-phenylpropanoate;hydrochloride is sourced from PubChem (CID 90679316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).