C22H36O5 — CID 90679336
(Z)-7-[(1R,5S,6R,7R)-7-[(E,3S)-3-hydroxyoct-1-enyl]-3-methyl-2,4-dioxabicyclo[3.2.1]octan-6-yl]hept-5-enoic acid (PubChem CID 90679336) has the molecular formula C22H36O5 and a molecular weight of 380.53 g/mol. Its IUPAC name is (Z)-7-[(1R,5S,6R,7R)-7-[(E,3S)-3-hydroxyoct-1-enyl]-3-methyl-2,4-dioxabicyclo[3.2.1]octan-6-yl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,5S,6R,7R)-7-[(E,3S)-3-hydroxyoct-1-enyl]-3-methyl-2,4-dioxabicyclo[3.2.1]octan-6-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 90679336 |
| Molecular Formula | C22H36O5 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.26 |
| IUPAC Name | (Z)-7-[(1R,5S,6R,7R)-7-[(E,3S)-3-hydroxyoct-1-enyl]-3-methyl-2,4-dioxabicyclo[3.2.1]octan-6-yl]hept-5-enoic acid |
| SMILES | CCCCC[C@H](O)/C=C/[C@@H]1[C@@H](C/C=C\CCCC(=O)O)[C@@H]2C[C@H]1OC(C)O2 |
| InChI | InChI=1S/C22H36O5/c1-3-4-7-10-17(23)13-14-19-18(11-8-5-6-9-12-22(24)25)20-15-21(19)27-16(2)26-20/h5,8,13-14,16-21,23H,3-4,6-7,9-12,15H2,1-2H3,(H,24,25)/b8-5-,14-13+/t16?,17-,18+,19+,20-,21+/m0/s1 |
| InChIKey | QJOXFJLTXPQRSO-NAVXEYGUSA-N |
| XLogP | 4.45 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|