C18H26O2 — CID 90679518
(6aS,7aS,8S,10aS,11aR,11bS)-8-hydroxy-7a-methyl-2,5,6,6a,7,8,9,10,10a,11,11a,11b-dodecahydro-1H-cyclopenta[b]phenanthren-3-one (PubChem CID 90679518) has the molecular formula C18H26O2 and a molecular weight of 274.40 g/mol. Its IUPAC name is (6aS,7aS,8S,10aS,11aR,11bS)-8-hydroxy-7a-methyl-2,5,6,6a,7,8,9,10,10a,11,11a,11b-dodecahydro-1H-cyclopenta[b]phenanthren-3-one.
| Compound Name | (6aS,7aS,8S,10aS,11aR,11bS)-8-hydroxy-7a-methyl-2,5,6,6a,7,8,9,10,10a,11,11a,11b-dodecahydro-1H-cyclopenta[b]phenanthren-3-one |
|---|---|
| PubChem CID | 90679518 |
| Molecular Formula | C18H26O2 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | (6aS,7aS,8S,10aS,11aR,11bS)-8-hydroxy-7a-methyl-2,5,6,6a,7,8,9,10,10a,11,11a,11b-dodecahydro-1H-cyclopenta[b]phenanthren-3-one |
| SMILES | C[C@]12C[C@@H]3CCC4=CC(=O)CC[C@H]4[C@@H]3C[C@@H]1CC[C@@H]2O |
| InChI | InChI=1S/C18H26O2/c1-18-10-12-3-2-11-8-14(19)5-6-15(11)16(12)9-13(18)4-7-17(18)20/h8,12-13,15-17,20H,2-7,9-10H2,1H3/t12-,13-,15+,16+,17-,18-/m0/s1 |
| InChIKey | MUJXIYICDVNDRP-WXPQKEBOSA-N |
| XLogP | 3.49 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |