C20H31NO2S — CID 90679961
methyl (1R,2S,3S,5R)-8-heptyl-2-thiophen-2-yl-8-azabicyclo[3.2.1]octane-3-carboxylate (PubChem CID 90679961) has the molecular formula C20H31NO2S and a molecular weight of 349.54 g/mol. Its IUPAC name is methyl (1R,2S,3S,5R)-8-heptyl-2-thiophen-2-yl-8-azabicyclo[3.2.1]octane-3-carboxylate.
| Compound Name | methyl (1R,2S,3S,5R)-8-heptyl-2-thiophen-2-yl-8-azabicyclo[3.2.1]octane-3-carboxylate |
|---|---|
| PubChem CID | 90679961 |
| Molecular Formula | C20H31NO2S |
| Molecular Weight | 349.54 g/mol |
| Exact Mass | 349.21 |
| IUPAC Name | methyl (1R,2S,3S,5R)-8-heptyl-2-thiophen-2-yl-8-azabicyclo[3.2.1]octane-3-carboxylate |
| SMILES | CCCCCCCN1[C@@H]2CC[C@@H]1[C@@H](c1cccs1)[C@@H](C(=O)OC)C2 |
| InChI | InChI=1S/C20H31NO2S/c1-3-4-5-6-7-12-21-15-10-11-17(21)19(18-9-8-13-24-18)16(14-15)20(22)23-2/h8-9,13,15-17,19H,3-7,10-12,14H2,1-2H3/t15-,16+,17-,19+/m1/s1 |
| InChIKey | FGDADZWGBYCKGD-NTDBWNAOSA-N |
| XLogP | 4.83 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.54 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|