C17H25NO3S — CID 90679969
methyl (1R,2S,3S,5R)-8-(2-ethoxyethyl)-2-thiophen-2-yl-8-azabicyclo[3.2.1]octane-3-carboxylate (PubChem CID 90679969) has the molecular formula C17H25NO3S and a molecular weight of 323.46 g/mol. Its IUPAC name is methyl (1R,2S,3S,5R)-8-(2-ethoxyethyl)-2-thiophen-2-yl-8-azabicyclo[3.2.1]octane-3-carboxylate.
| Compound Name | methyl (1R,2S,3S,5R)-8-(2-ethoxyethyl)-2-thiophen-2-yl-8-azabicyclo[3.2.1]octane-3-carboxylate |
|---|---|
| PubChem CID | 90679969 |
| Molecular Formula | C17H25NO3S |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | methyl (1R,2S,3S,5R)-8-(2-ethoxyethyl)-2-thiophen-2-yl-8-azabicyclo[3.2.1]octane-3-carboxylate |
| SMILES | CCOCCN1[C@@H]2CC[C@@H]1[C@@H](c1cccs1)[C@@H](C(=O)OC)C2 |
| InChI | InChI=1S/C17H25NO3S/c1-3-21-9-8-18-12-6-7-14(18)16(15-5-4-10-22-15)13(11-12)17(19)20-2/h4-5,10,12-14,16H,3,6-9,11H2,1-2H3/t12-,13+,14-,16+/m1/s1 |
| InChIKey | FNUWYOWSMWIROW-CTASWTNQSA-N |
| XLogP | 2.89 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|