About (1S,2S)-1,2-diphenyl-2-[2-(propan-2-ylideneamino)ethylamino]ethanol
(1S,2S)-1,2-diphenyl-2-[2-(propan-2-ylideneamino)ethylamino]ethanol (PubChem CID 90680250) has the molecular formula C19H24N2O
and a molecular weight of 296.41 g/mol. Its IUPAC name is (1S,2S)-1,2-diphenyl-2-[2-(propan-2-ylideneamino)ethylamino]ethanol.
Molecular Properties
| Compound Name | (1S,2S)-1,2-diphenyl-2-[2-(propan-2-ylideneamino)ethylamino]ethanol |
| PubChem CID | 90680250 |
| Molecular Formula | C19H24N2O |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.19 |
| IUPAC Name | (1S,2S)-1,2-diphenyl-2-[2-(propan-2-ylideneamino)ethylamino]ethanol |
| SMILES | CC(C)=NCCN[C@@H](c1ccccc1)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C19H24N2O/c1-15(2)20-13-14-21-18(16-9-5-3-6-10-16)19(22)17-11-7-4-8-12-17/h3-12,18-19,21-22H,13-14H2,1-2H3/t18-,19-/m0/s1 |
| InChIKey | FNWMEASGITXBEN-OALUTQOASA-N |
| XLogP | 3.53 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (1S,2S)-1,2-diphenyl-2-[2-(propan-2-ylideneamino)ethylamino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,2S)-1,2-diphenyl-2-[2-(propan-2-ylideneamino)ethylamino]ethanol?
The IUPAC name of (1S,2S)-1,2-diphenyl-2-[2-(propan-2-ylideneamino)ethylamino]ethanol (CID 90680250) is (1S,2S)-1,2-diphenyl-2-[2-(propan-2-ylideneamino)ethylamino]ethanol.
What is the SMILES notation for (1S,2S)-1,2-diphenyl-2-[2-(propan-2-ylideneamino)ethylamino]ethanol?
The canonical SMILES for (1S,2S)-1,2-diphenyl-2-[2-(propan-2-ylideneamino)ethylamino]ethanol is CC(C)=NCCN[C@@H](c1ccccc1)[C@@H](O)c1ccccc1.
What is the InChIKey of (1S,2S)-1,2-diphenyl-2-[2-(propan-2-ylideneamino)ethylamino]ethanol?
The InChIKey is FNWMEASGITXBEN-OALUTQOASA-N. The full InChI is InChI=1S/C19H24N2O/c1-15(2)20-13-14-21-18(16-9-5-3-6-10-16)19(22)17-11-7-4-8-12-17/h3-12,18-19,21-22H,13-14H2,1-2H3/t18-,19-/m0/s1.
What are the key properties of (1S,2S)-1,2-diphenyl-2-[2-(propan-2-ylideneamino)ethylamino]ethanol?
(1S,2S)-1,2-diphenyl-2-[2-(propan-2-ylideneamino)ethylamino]ethanol has a molecular weight of 296.41 g/mol, XLogP of 3.53, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,2S)-1,2-diphenyl-2-[2-(propan-2-ylideneamino)ethylamino]ethanol is sourced from PubChem (CID 90680250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).