C30H32N2O2 — CID 90680251
(1S,2S)-2-[2-[[(1S,2S)-2-hydroxy-1,2-diphenylethyl]amino]ethylamino]-1,2-diphenylethanol (PubChem CID 90680251) has the molecular formula C30H32N2O2 and a molecular weight of 452.60 g/mol. Its IUPAC name is (1S,2S)-2-[2-[[(1S,2S)-2-hydroxy-1,2-diphenylethyl]amino]ethylamino]-1,2-diphenylethanol.
| Compound Name | (1S,2S)-2-[2-[[(1S,2S)-2-hydroxy-1,2-diphenylethyl]amino]ethylamino]-1,2-diphenylethanol |
|---|---|
| PubChem CID | 90680251 |
| Molecular Formula | C30H32N2O2 |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.25 |
| IUPAC Name | (1S,2S)-2-[2-[[(1S,2S)-2-hydroxy-1,2-diphenylethyl]amino]ethylamino]-1,2-diphenylethanol |
| SMILES | O[C@@H](c1ccccc1)[C@@H](NCCN[C@@H](c1ccccc1)[C@@H](O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H32N2O2/c33-29(25-17-9-3-10-18-25)27(23-13-5-1-6-14-23)31-21-22-32-28(24-15-7-2-8-16-24)30(34)26-19-11-4-12-20-26/h1-20,27-34H,21-22H2/t27-,28-,29-,30-/m0/s1 |
| InChIKey | ZZNZLXAFYMPHAD-KRCBVYEFSA-N |
| XLogP | 5.12 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|