About [(1S,2S)-2-[2-acetamidoethyl(acetyl)amino]-1,2-diphenylethyl] acetate
[(1S,2S)-2-[2-acetamidoethyl(acetyl)amino]-1,2-diphenylethyl] acetate (PubChem CID 90680258) has the molecular formula C22H26N2O4
and a molecular weight of 382.46 g/mol. Its IUPAC name is [(1S,2S)-2-[2-acetamidoethyl(acetyl)amino]-1,2-diphenylethyl] acetate.
Molecular Properties
| Compound Name | [(1S,2S)-2-[2-acetamidoethyl(acetyl)amino]-1,2-diphenylethyl] acetate |
| PubChem CID | 90680258 |
| Molecular Formula | C22H26N2O4 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | [(1S,2S)-2-[2-acetamidoethyl(acetyl)amino]-1,2-diphenylethyl] acetate |
| SMILES | CC(=O)NCCN(C(C)=O)[C@@H](c1ccccc1)[C@@H](OC(C)=O)c1ccccc1 |
| InChI | InChI=1S/C22H26N2O4/c1-16(25)23-14-15-24(17(2)26)21(19-10-6-4-7-11-19)22(28-18(3)27)20-12-8-5-9-13-20/h4-13,21-22H,14-15H2,1-3H3,(H,23,25)/t21-,22-/m0/s1 |
| InChIKey | KHAAQEOHNGZBOE-VXKWHMMOSA-N |
| XLogP | 3.02 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(1S,2S)-2-[2-acetamidoethyl(acetyl)amino]-1,2-diphenylethyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,2S)-2-[2-acetamidoethyl(acetyl)amino]-1,2-diphenylethyl] acetate?
The IUPAC name of [(1S,2S)-2-[2-acetamidoethyl(acetyl)amino]-1,2-diphenylethyl] acetate (CID 90680258) is [(1S,2S)-2-[2-acetamidoethyl(acetyl)amino]-1,2-diphenylethyl] acetate.
What is the SMILES notation for [(1S,2S)-2-[2-acetamidoethyl(acetyl)amino]-1,2-diphenylethyl] acetate?
The canonical SMILES for [(1S,2S)-2-[2-acetamidoethyl(acetyl)amino]-1,2-diphenylethyl] acetate is CC(=O)NCCN(C(C)=O)[C@@H](c1ccccc1)[C@@H](OC(C)=O)c1ccccc1.
What is the InChIKey of [(1S,2S)-2-[2-acetamidoethyl(acetyl)amino]-1,2-diphenylethyl] acetate?
The InChIKey is KHAAQEOHNGZBOE-VXKWHMMOSA-N. The full InChI is InChI=1S/C22H26N2O4/c1-16(25)23-14-15-24(17(2)26)21(19-10-6-4-7-11-19)22(28-18(3)27)20-12-8-5-9-13-20/h4-13,21-22H,14-15H2,1-3H3,(H,23,25)/t21-,22-/m0/s1.
What are the key properties of [(1S,2S)-2-[2-acetamidoethyl(acetyl)amino]-1,2-diphenylethyl] acetate?
[(1S,2S)-2-[2-acetamidoethyl(acetyl)amino]-1,2-diphenylethyl] acetate has a molecular weight of 382.46 g/mol, XLogP of 3.02, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,2S)-2-[2-acetamidoethyl(acetyl)amino]-1,2-diphenylethyl] acetate is sourced from PubChem (CID 90680258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).