C22H35IN4O7 — CID 90680364
tert-butyl (2R)-2-[[(2R)-2-[[(2S)-6-(2,5-dioxopyrrolidin-1-yl)-2-[(2-iodoacetyl)amino]hexanoyl]amino]propanoyl]amino]propanoate (PubChem CID 90680364) has the molecular formula C22H35IN4O7 and a molecular weight of 594.45 g/mol. Its IUPAC name is tert-butyl (2R)-2-[[(2R)-2-[[(2S)-6-(2,5-dioxopyrrolidin-1-yl)-2-[(2-iodoacetyl)amino]hexanoyl]amino]propanoyl]amino]propanoate.
| Compound Name | tert-butyl (2R)-2-[[(2R)-2-[[(2S)-6-(2,5-dioxopyrrolidin-1-yl)-2-[(2-iodoacetyl)amino]hexanoyl]amino]propanoyl]amino]propanoate |
|---|---|
| PubChem CID | 90680364 |
| Molecular Formula | C22H35IN4O7 |
| Molecular Weight | 594.45 g/mol |
| Exact Mass | 594.16 |
| IUPAC Name | tert-butyl (2R)-2-[[(2R)-2-[[(2S)-6-(2,5-dioxopyrrolidin-1-yl)-2-[(2-iodoacetyl)amino]hexanoyl]amino]propanoyl]amino]propanoate |
| SMILES | C[C@@H](NC(=O)[C@H](CCCCN1C(=O)CCC1=O)NC(=O)CI)C(=O)N[C@H](C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H35IN4O7/c1-13(19(31)25-14(2)21(33)34-22(3,4)5)24-20(32)15(26-16(28)12-23)8-6-7-11-27-17(29)9-10-18(27)30/h13-15H,6-12H2,1-5H3,(H,24,32)(H,25,31)(H,26,28)/t13-,14-,15+/m1/s1 |
| InChIKey | LAZAGQKFLHYWAY-KFWWJZLASA-N |
| XLogP | 0.58 |
| TPSA | 150.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.45 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|