About 5-[[(2S)-6-(1,3-dioxoisoindol-2-yl)-2-[(2-iodoacetyl)amino]hexanoyl]amino]pentanoic acid
5-[[(2S)-6-(1,3-dioxoisoindol-2-yl)-2-[(2-iodoacetyl)amino]hexanoyl]amino]pentanoic acid (PubChem CID 90680384) has the molecular formula C21H26IN3O6
and a molecular weight of 543.36 g/mol. Its IUPAC name is 5-[[(2S)-6-(1,3-dioxoisoindol-2-yl)-2-[(2-iodoacetyl)amino]hexanoyl]amino]pentanoic acid.
Molecular Properties
| Compound Name | 5-[[(2S)-6-(1,3-dioxoisoindol-2-yl)-2-[(2-iodoacetyl)amino]hexanoyl]amino]pentanoic acid |
| PubChem CID | 90680384 |
| Molecular Formula | C21H26IN3O6 |
| Molecular Weight | 543.36 g/mol |
| Exact Mass | 543.09 |
| IUPAC Name | 5-[[(2S)-6-(1,3-dioxoisoindol-2-yl)-2-[(2-iodoacetyl)amino]hexanoyl]amino]pentanoic acid |
| SMILES | O=C(O)CCCCNC(=O)[C@H](CCCCN1C(=O)c2ccccc2C1=O)NC(=O)CI |
| InChI | InChI=1S/C21H26IN3O6/c22-13-17(26)24-16(19(29)23-11-5-3-10-18(27)28)9-4-6-12-25-20(30)14-7-1-2-8-15(14)21(25)31/h1-2,7-8,16H,3-6,9-13H2,(H,23,29)(H,24,26)(H,27,28)/t16-/m0/s1 |
| InChIKey | AFDLNQLUFVHQSK-INIZCTEOSA-N |
| XLogP | 1.74 |
| TPSA | 132.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 543.36 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 5-[[(2S)-6-(1,3-dioxoisoindol-2-yl)-2-[(2-iodoacetyl)amino]hexanoyl]amino]pentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[(2S)-6-(1,3-dioxoisoindol-2-yl)-2-[(2-iodoacetyl)amino]hexanoyl]amino]pentanoic acid?
The IUPAC name of 5-[[(2S)-6-(1,3-dioxoisoindol-2-yl)-2-[(2-iodoacetyl)amino]hexanoyl]amino]pentanoic acid (CID 90680384) is 5-[[(2S)-6-(1,3-dioxoisoindol-2-yl)-2-[(2-iodoacetyl)amino]hexanoyl]amino]pentanoic acid.
What is the SMILES notation for 5-[[(2S)-6-(1,3-dioxoisoindol-2-yl)-2-[(2-iodoacetyl)amino]hexanoyl]amino]pentanoic acid?
The canonical SMILES for 5-[[(2S)-6-(1,3-dioxoisoindol-2-yl)-2-[(2-iodoacetyl)amino]hexanoyl]amino]pentanoic acid is O=C(O)CCCCNC(=O)[C@H](CCCCN1C(=O)c2ccccc2C1=O)NC(=O)CI.
What is the InChIKey of 5-[[(2S)-6-(1,3-dioxoisoindol-2-yl)-2-[(2-iodoacetyl)amino]hexanoyl]amino]pentanoic acid?
The InChIKey is AFDLNQLUFVHQSK-INIZCTEOSA-N. The full InChI is InChI=1S/C21H26IN3O6/c22-13-17(26)24-16(19(29)23-11-5-3-10-18(27)28)9-4-6-12-25-20(30)14-7-1-2-8-15(14)21(25)31/h1-2,7-8,16H,3-6,9-13H2,(H,23,29)(H,24,26)(H,27,28)/t16-/m0/s1.
What are the key properties of 5-[[(2S)-6-(1,3-dioxoisoindol-2-yl)-2-[(2-iodoacetyl)amino]hexanoyl]amino]pentanoic acid?
5-[[(2S)-6-(1,3-dioxoisoindol-2-yl)-2-[(2-iodoacetyl)amino]hexanoyl]amino]pentanoic acid has a molecular weight of 543.36 g/mol, XLogP of 1.74, 13 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[(2S)-6-(1,3-dioxoisoindol-2-yl)-2-[(2-iodoacetyl)amino]hexanoyl]amino]pentanoic acid is sourced from PubChem (CID 90680384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).