C19H25N2OS+ — CID 90680516
(2R)-1-[[(2S)-oxolan-2-yl]methyl]-2-phenyl-5,6,7,8-tetrahydro-2H-quinazolin-3-ium-4-thiol (PubChem CID 90680516) has the molecular formula C19H25N2OS+ and a molecular weight of 329.49 g/mol. Its IUPAC name is (2R)-1-[[(2S)-oxolan-2-yl]methyl]-2-phenyl-5,6,7,8-tetrahydro-2H-quinazolin-3-ium-4-thiol.
| Compound Name | (2R)-1-[[(2S)-oxolan-2-yl]methyl]-2-phenyl-5,6,7,8-tetrahydro-2H-quinazolin-3-ium-4-thiol |
|---|---|
| PubChem CID | 90680516 |
| Molecular Formula | C19H25N2OS+ |
| Molecular Weight | 329.49 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | (2R)-1-[[(2S)-oxolan-2-yl]methyl]-2-phenyl-5,6,7,8-tetrahydro-2H-quinazolin-3-ium-4-thiol |
| SMILES | SC1=[NH+][C@H](c2ccccc2)N(C[C@@H]2CCCO2)C2=C1CCCC2 |
| InChI | InChI=1S/C19H24N2OS/c23-19-16-10-4-5-11-17(16)21(13-15-9-6-12-22-15)18(20-19)14-7-2-1-3-8-14/h1-3,7-8,15,18H,4-6,9-13H2,(H,20,23)/p+1/t15-,18-/m0/s1 |
| InChIKey | RXVQOODXQFDNAH-YJBOKZPZSA-O |
| XLogP | 2.42 |
| TPSA | 26.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.49 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|