C27H41N3O4S3 — CID 90680749
[(E)-5-octanoylsulfanylpent-2-enyl] (2S)-3-methyl-2-[[(4R)-4-methyl-2-(2-methyl-1,3-thiazol-4-yl)-5H-1,3-thiazole-4-carbonyl]amino]butanoate (PubChem CID 90680749) has the molecular formula C27H41N3O4S3 and a molecular weight of 567.84 g/mol. Its IUPAC name is [(E)-5-octanoylsulfanylpent-2-enyl] (2S)-3-methyl-2-[[(4R)-4-methyl-2-(2-methyl-1,3-thiazol-4-yl)-5H-1,3-thiazole-4-carbonyl]amino]butanoate.
| Compound Name | [(E)-5-octanoylsulfanylpent-2-enyl] (2S)-3-methyl-2-[[(4R)-4-methyl-2-(2-methyl-1,3-thiazol-4-yl)-5H-1,3-thiazole-4-carbonyl]amino]butanoate |
|---|---|
| PubChem CID | 90680749 |
| Molecular Formula | C27H41N3O4S3 |
| Molecular Weight | 567.84 g/mol |
| Exact Mass | 567.23 |
| IUPAC Name | [(E)-5-octanoylsulfanylpent-2-enyl] (2S)-3-methyl-2-[[(4R)-4-methyl-2-(2-methyl-1,3-thiazol-4-yl)-5H-1,3-thiazole-4-carbonyl]amino]butanoate |
| SMILES | CCCCCCCC(=O)SCC/C=C/COC(=O)[C@@H](NC(=O)[C@]1(C)CSC(c2csc(C)n2)=N1)C(C)C |
| InChI | InChI=1S/C27H41N3O4S3/c1-6-7-8-9-11-14-22(31)35-16-13-10-12-15-34-25(32)23(19(2)3)29-26(33)27(5)18-37-24(30-27)21-17-36-20(4)28-21/h10,12,17,19,23H,6-9,11,13-16,18H2,1-5H3,(H,29,33)/b12-10+/t23-,27-/m0/s1 |
| InChIKey | HUOAYHKPKMCJMJ-UKDPGZEGSA-N |
| XLogP | 5.95 |
| TPSA | 97.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.84 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|