C62H54N4O8 — CID 90680761
1-N,3-N-bis[4-[2-oxo-4-[4-(2-pyrrolidin-1-ylethoxy)phenyl]chromen-3-yl]phenyl]benzene-1,3-dicarboxamide (PubChem CID 90680761) has the molecular formula C62H54N4O8 and a molecular weight of 983.13 g/mol. Its IUPAC name is 1-N,3-N-bis[4-[2-oxo-4-[4-(2-pyrrolidin-1-ylethoxy)phenyl]chromen-3-yl]phenyl]benzene-1,3-dicarboxamide.
| Compound Name | 1-N,3-N-bis[4-[2-oxo-4-[4-(2-pyrrolidin-1-ylethoxy)phenyl]chromen-3-yl]phenyl]benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 90680761 |
| Molecular Formula | C62H54N4O8 |
| Molecular Weight | 983.13 g/mol |
| Exact Mass | 982.39 |
| IUPAC Name | 1-N,3-N-bis[4-[2-oxo-4-[4-(2-pyrrolidin-1-ylethoxy)phenyl]chromen-3-yl]phenyl]benzene-1,3-dicarboxamide |
| SMILES | O=C(Nc1ccc(-c2c(-c3ccc(OCCN4CCCC4)cc3)c3ccccc3oc2=O)cc1)c1cccc(C(=O)Nc2ccc(-c3c(-c4ccc(OCCN5CCCC5)cc4)c4ccccc4oc3=O)cc2)c1 |
| InChI | InChI=1S/C62H54N4O8/c67-59(63-47-24-16-43(17-25-47)57-55(51-12-1-3-14-53(51)73-61(57)69)41-20-28-49(29-21-41)71-38-36-65-32-5-6-33-65)45-10-9-11-46(40-45)60(68)64-48-26-18-44(19-27-48)58-56(52-13-2-4-15-54(52)74-62(58)70)42-22-30-50(31-23-42)72-39-37-66-34-7-8-35-66/h1-4,9-31,40H,5-8,32-39H2,(H,63,67)(H,64,68) |
| InChIKey | SVZUUASXGWKIIF-UHFFFAOYSA-N |
| XLogP | 12.02 |
| TPSA | 143.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 983.13 |
| LogP ≤ 5 | 12.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|