About 2-(3,4-dimethoxyphenyl)-5-methoxy-1,3-dimethylindole
2-(3,4-dimethoxyphenyl)-5-methoxy-1,3-dimethylindole (PubChem CID 90680785) has the molecular formula C19H21NO3
and a molecular weight of 311.38 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-5-methoxy-1,3-dimethylindole.
Molecular Properties
| Compound Name | 2-(3,4-dimethoxyphenyl)-5-methoxy-1,3-dimethylindole |
| PubChem CID | 90680785 |
| Molecular Formula | C19H21NO3 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-5-methoxy-1,3-dimethylindole |
| SMILES | COc1ccc2c(c1)c(C)c(-c1ccc(OC)c(OC)c1)n2C |
| InChI | InChI=1S/C19H21NO3/c1-12-15-11-14(21-3)7-8-16(15)20(2)19(12)13-6-9-17(22-4)18(10-13)23-5/h6-11H,1-5H3 |
| InChIKey | STAXGIBBSVZVCS-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 32.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(3,4-dimethoxyphenyl)-5-methoxy-1,3-dimethylindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,4-dimethoxyphenyl)-5-methoxy-1,3-dimethylindole?
The IUPAC name of 2-(3,4-dimethoxyphenyl)-5-methoxy-1,3-dimethylindole (CID 90680785) is 2-(3,4-dimethoxyphenyl)-5-methoxy-1,3-dimethylindole.
What is the SMILES notation for 2-(3,4-dimethoxyphenyl)-5-methoxy-1,3-dimethylindole?
The canonical SMILES for 2-(3,4-dimethoxyphenyl)-5-methoxy-1,3-dimethylindole is COc1ccc2c(c1)c(C)c(-c1ccc(OC)c(OC)c1)n2C.
What is the InChIKey of 2-(3,4-dimethoxyphenyl)-5-methoxy-1,3-dimethylindole?
The InChIKey is STAXGIBBSVZVCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21NO3/c1-12-15-11-14(21-3)7-8-16(15)20(2)19(12)13-6-9-17(22-4)18(10-13)23-5/h6-11H,1-5H3.
What are the key properties of 2-(3,4-dimethoxyphenyl)-5-methoxy-1,3-dimethylindole?
2-(3,4-dimethoxyphenyl)-5-methoxy-1,3-dimethylindole has a molecular weight of 311.38 g/mol, XLogP of 4.18, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,4-dimethoxyphenyl)-5-methoxy-1,3-dimethylindole is sourced from PubChem (CID 90680785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).