C22H22ClF3N2O — CID 90680901
5-[3-(4-chlorophenoxy)propyl]-2-methyl-8-(trifluoromethyl)-3,4-dihydro-1H-pyrido[4,3-b]indole (PubChem CID 90680901) has the molecular formula C22H22ClF3N2O and a molecular weight of 422.88 g/mol. Its IUPAC name is 5-[3-(4-chlorophenoxy)propyl]-2-methyl-8-(trifluoromethyl)-3,4-dihydro-1H-pyrido[4,3-b]indole.
| Compound Name | 5-[3-(4-chlorophenoxy)propyl]-2-methyl-8-(trifluoromethyl)-3,4-dihydro-1H-pyrido[4,3-b]indole |
|---|---|
| PubChem CID | 90680901 |
| Molecular Formula | C22H22ClF3N2O |
| Molecular Weight | 422.88 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | 5-[3-(4-chlorophenoxy)propyl]-2-methyl-8-(trifluoromethyl)-3,4-dihydro-1H-pyrido[4,3-b]indole |
| SMILES | CN1CCc2c(c3cc(C(F)(F)F)ccc3n2CCCOc2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C22H22ClF3N2O/c1-27-11-9-21-19(14-27)18-13-15(22(24,25)26)3-8-20(18)28(21)10-2-12-29-17-6-4-16(23)5-7-17/h3-8,13H,2,9-12,14H2,1H3 |
| InChIKey | XBYPGKZSUUYCRK-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 17.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.88 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|