C26H29N3O4S — CID 90681061
N-butan-2-yl-2-[[3-[(2,5-dimethylphenyl)sulfamoyl]benzoyl]amino]benzamide (PubChem CID 90681061) has the molecular formula C26H29N3O4S and a molecular weight of 479.60 g/mol. Its IUPAC name is N-butan-2-yl-2-[[3-[(2,5-dimethylphenyl)sulfamoyl]benzoyl]amino]benzamide.
| Compound Name | N-butan-2-yl-2-[[3-[(2,5-dimethylphenyl)sulfamoyl]benzoyl]amino]benzamide |
|---|---|
| PubChem CID | 90681061 |
| Molecular Formula | C26H29N3O4S |
| Molecular Weight | 479.60 g/mol |
| Exact Mass | 479.19 |
| IUPAC Name | N-butan-2-yl-2-[[3-[(2,5-dimethylphenyl)sulfamoyl]benzoyl]amino]benzamide |
| SMILES | CCC(C)NC(=O)c1ccccc1NC(=O)c1cccc(S(=O)(=O)Nc2cc(C)ccc2C)c1 |
| InChI | InChI=1S/C26H29N3O4S/c1-5-19(4)27-26(31)22-11-6-7-12-23(22)28-25(30)20-9-8-10-21(16-20)34(32,33)29-24-15-17(2)13-14-18(24)3/h6-16,19,29H,5H2,1-4H3,(H,27,31)(H,28,30) |
| InChIKey | RSAMYFUHJKFGCA-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.60 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |