About 7-chloro-4-(trichloromethyl)pyrrolo[1,2-a]quinoxaline
7-chloro-4-(trichloromethyl)pyrrolo[1,2-a]quinoxaline (PubChem CID 90681125) has the molecular formula C12H6Cl4N2
and a molecular weight of 320.01 g/mol. Its IUPAC name is 7-chloro-4-(trichloromethyl)pyrrolo[1,2-a]quinoxaline.
Molecular Properties
| Compound Name | 7-chloro-4-(trichloromethyl)pyrrolo[1,2-a]quinoxaline |
| PubChem CID | 90681125 |
| Molecular Formula | C12H6Cl4N2 |
| Molecular Weight | 320.01 g/mol |
| Exact Mass | 317.93 |
| IUPAC Name | 7-chloro-4-(trichloromethyl)pyrrolo[1,2-a]quinoxaline |
| SMILES | Clc1ccc2c(c1)nc(C(Cl)(Cl)Cl)c1cccn12 |
| InChI | InChI=1S/C12H6Cl4N2/c13-7-3-4-9-8(6-7)17-11(12(14,15)16)10-2-1-5-18(9)10/h1-6H |
| InChIKey | LVHHHNAXQQDNHZ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.01 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 7-chloro-4-(trichloromethyl)pyrrolo[1,2-a]quinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-4-(trichloromethyl)pyrrolo[1,2-a]quinoxaline?
The IUPAC name of 7-chloro-4-(trichloromethyl)pyrrolo[1,2-a]quinoxaline (CID 90681125) is 7-chloro-4-(trichloromethyl)pyrrolo[1,2-a]quinoxaline.
What is the SMILES notation for 7-chloro-4-(trichloromethyl)pyrrolo[1,2-a]quinoxaline?
The canonical SMILES for 7-chloro-4-(trichloromethyl)pyrrolo[1,2-a]quinoxaline is Clc1ccc2c(c1)nc(C(Cl)(Cl)Cl)c1cccn12.
What is the InChIKey of 7-chloro-4-(trichloromethyl)pyrrolo[1,2-a]quinoxaline?
The InChIKey is LVHHHNAXQQDNHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H6Cl4N2/c13-7-3-4-9-8(6-7)17-11(12(14,15)16)10-2-1-5-18(9)10/h1-6H.
What are the key properties of 7-chloro-4-(trichloromethyl)pyrrolo[1,2-a]quinoxaline?
7-chloro-4-(trichloromethyl)pyrrolo[1,2-a]quinoxaline has a molecular weight of 320.01 g/mol, XLogP of 4.97, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-4-(trichloromethyl)pyrrolo[1,2-a]quinoxaline is sourced from PubChem (CID 90681125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).