About 4-(2-chlorophenyl)-N,N-dimethyl-4-pyridin-2-ylbutan-1-amine
4-(2-chlorophenyl)-N,N-dimethyl-4-pyridin-2-ylbutan-1-amine (PubChem CID 90681231) has the molecular formula C17H21ClN2
and a molecular weight of 288.82 g/mol. Its IUPAC name is 4-(2-chlorophenyl)-N,N-dimethyl-4-pyridin-2-ylbutan-1-amine.
Molecular Properties
| Compound Name | 4-(2-chlorophenyl)-N,N-dimethyl-4-pyridin-2-ylbutan-1-amine |
| PubChem CID | 90681231 |
| Molecular Formula | C17H21ClN2 |
| Molecular Weight | 288.82 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 4-(2-chlorophenyl)-N,N-dimethyl-4-pyridin-2-ylbutan-1-amine |
| SMILES | CN(C)CCCC(c1ccccn1)c1ccccc1Cl |
| InChI | InChI=1S/C17H21ClN2/c1-20(2)13-7-9-15(17-11-5-6-12-19-17)14-8-3-4-10-16(14)18/h3-6,8,10-12,15H,7,9,13H2,1-2H3 |
| InChIKey | VHZCQDQABCMPTO-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.82 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(2-chlorophenyl)-N,N-dimethyl-4-pyridin-2-ylbutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-chlorophenyl)-N,N-dimethyl-4-pyridin-2-ylbutan-1-amine?
The IUPAC name of 4-(2-chlorophenyl)-N,N-dimethyl-4-pyridin-2-ylbutan-1-amine (CID 90681231) is 4-(2-chlorophenyl)-N,N-dimethyl-4-pyridin-2-ylbutan-1-amine.
What is the SMILES notation for 4-(2-chlorophenyl)-N,N-dimethyl-4-pyridin-2-ylbutan-1-amine?
The canonical SMILES for 4-(2-chlorophenyl)-N,N-dimethyl-4-pyridin-2-ylbutan-1-amine is CN(C)CCCC(c1ccccn1)c1ccccc1Cl.
What is the InChIKey of 4-(2-chlorophenyl)-N,N-dimethyl-4-pyridin-2-ylbutan-1-amine?
The InChIKey is VHZCQDQABCMPTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21ClN2/c1-20(2)13-7-9-15(17-11-5-6-12-19-17)14-8-3-4-10-16(14)18/h3-6,8,10-12,15H,7,9,13H2,1-2H3.
What are the key properties of 4-(2-chlorophenyl)-N,N-dimethyl-4-pyridin-2-ylbutan-1-amine?
4-(2-chlorophenyl)-N,N-dimethyl-4-pyridin-2-ylbutan-1-amine has a molecular weight of 288.82 g/mol, XLogP of 4.21, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-chlorophenyl)-N,N-dimethyl-4-pyridin-2-ylbutan-1-amine is sourced from PubChem (CID 90681231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).