About 2-(3-fluorophenyl)-4,8-dimethylpyrazolo[1,5-a]quinazolin-5-one
2-(3-fluorophenyl)-4,8-dimethylpyrazolo[1,5-a]quinazolin-5-one (PubChem CID 90681336) has the molecular formula C18H14FN3O
and a molecular weight of 307.33 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-4,8-dimethylpyrazolo[1,5-a]quinazolin-5-one.
Molecular Properties
| Compound Name | 2-(3-fluorophenyl)-4,8-dimethylpyrazolo[1,5-a]quinazolin-5-one |
| PubChem CID | 90681336 |
| Molecular Formula | C18H14FN3O |
| Molecular Weight | 307.33 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | 2-(3-fluorophenyl)-4,8-dimethylpyrazolo[1,5-a]quinazolin-5-one |
| SMILES | Cc1ccc2c(=O)n(C)c3cc(-c4cccc(F)c4)nn3c2c1 |
| InChI | InChI=1S/C18H14FN3O/c1-11-6-7-14-16(8-11)22-17(21(2)18(14)23)10-15(20-22)12-4-3-5-13(19)9-12/h3-10H,1-2H3 |
| InChIKey | VLDXRHJNJNUMFF-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 39.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.33 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(3-fluorophenyl)-4,8-dimethylpyrazolo[1,5-a]quinazolin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-fluorophenyl)-4,8-dimethylpyrazolo[1,5-a]quinazolin-5-one?
The IUPAC name of 2-(3-fluorophenyl)-4,8-dimethylpyrazolo[1,5-a]quinazolin-5-one (CID 90681336) is 2-(3-fluorophenyl)-4,8-dimethylpyrazolo[1,5-a]quinazolin-5-one.
What is the SMILES notation for 2-(3-fluorophenyl)-4,8-dimethylpyrazolo[1,5-a]quinazolin-5-one?
The canonical SMILES for 2-(3-fluorophenyl)-4,8-dimethylpyrazolo[1,5-a]quinazolin-5-one is Cc1ccc2c(=O)n(C)c3cc(-c4cccc(F)c4)nn3c2c1.
What is the InChIKey of 2-(3-fluorophenyl)-4,8-dimethylpyrazolo[1,5-a]quinazolin-5-one?
The InChIKey is VLDXRHJNJNUMFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14FN3O/c1-11-6-7-14-16(8-11)22-17(21(2)18(14)23)10-15(20-22)12-4-3-5-13(19)9-12/h3-10H,1-2H3.
What are the key properties of 2-(3-fluorophenyl)-4,8-dimethylpyrazolo[1,5-a]quinazolin-5-one?
2-(3-fluorophenyl)-4,8-dimethylpyrazolo[1,5-a]quinazolin-5-one has a molecular weight of 307.33 g/mol, XLogP of 3.30, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-fluorophenyl)-4,8-dimethylpyrazolo[1,5-a]quinazolin-5-one is sourced from PubChem (CID 90681336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).