C37H49FN2O2 — CID 90681548
(1R,2S,5S,8R,9S,10S,14R,15R,23R)-20-(4-fluorophenyl)-1,2,8,9,15,22,22-heptamethyl-19,20-diazahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-11,17(21),18-triene-5-carboxylic acid (PubChem CID 90681548) has the molecular formula C37H49FN2O2 and a molecular weight of 572.81 g/mol. Its IUPAC name is (1R,2S,5S,8R,9S,10S,14R,15R,23R)-20-(4-fluorophenyl)-1,2,8,9,15,22,22-heptamethyl-19,20-diazahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-11,17(21),18-triene-5-carboxylic acid.
| Compound Name | (1R,2S,5S,8R,9S,10S,14R,15R,23R)-20-(4-fluorophenyl)-1,2,8,9,15,22,22-heptamethyl-19,20-diazahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-11,17(21),18-triene-5-carboxylic acid |
|---|---|
| PubChem CID | 90681548 |
| Molecular Formula | C37H49FN2O2 |
| Molecular Weight | 572.81 g/mol |
| Exact Mass | 572.38 |
| IUPAC Name | (1R,2S,5S,8R,9S,10S,14R,15R,23R)-20-(4-fluorophenyl)-1,2,8,9,15,22,22-heptamethyl-19,20-diazahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-11,17(21),18-triene-5-carboxylic acid |
| SMILES | C[C@H]1[C@H](C)CC[C@]2(C(=O)O)CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)Cc6cnn(-c7ccc(F)cc7)c6C(C)(C)[C@@H]5CC[C@]43C)[C@H]12 |
| InChI | InChI=1S/C37H49FN2O2/c1-22-14-17-37(32(41)42)19-18-35(6)27(30(37)23(22)2)12-13-29-34(5)20-24-21-39-40(26-10-8-25(38)9-11-26)31(24)33(3,4)28(34)15-16-36(29,35)7/h8-12,21-23,28-30H,13-20H2,1-7H3,(H,41,42)/t22-,23+,28+,29-,30+,34+,35-,36-,37+/m1/s1 |
| InChIKey | DQELCQVUTLKBMU-IDSDQTAJSA-N |
| XLogP | 8.77 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.81 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|