C25H24N2O4 — CID 90681579
(E)-3-(9-ethylpyrido[3,4-b]indol-1-yl)-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one (PubChem CID 90681579) has the molecular formula C25H24N2O4 and a molecular weight of 416.48 g/mol. Its IUPAC name is (E)-3-(9-ethylpyrido[3,4-b]indol-1-yl)-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-(9-ethylpyrido[3,4-b]indol-1-yl)-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 90681579 |
| Molecular Formula | C25H24N2O4 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | (E)-3-(9-ethylpyrido[3,4-b]indol-1-yl)-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
| SMILES | CCn1c2ccccc2c2ccnc(/C=C/C(=O)c3cc(OC)c(OC)c(OC)c3)c21 |
| InChI | InChI=1S/C25H24N2O4/c1-5-27-20-9-7-6-8-17(20)18-12-13-26-19(24(18)27)10-11-21(28)16-14-22(29-2)25(31-4)23(15-16)30-3/h6-15H,5H2,1-4H3/b11-10+ |
| InChIKey | GZCHXJPJRHFKND-ZHACJKMWSA-N |
| XLogP | 5.13 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|