C21H16Br2N2O2 — CID 90681676
(3E,6E)-3,6-bis[(3-bromophenyl)methylidene]-1-prop-2-enylpiperazine-2,5-dione (PubChem CID 90681676) has the molecular formula C21H16Br2N2O2 and a molecular weight of 488.18 g/mol. Its IUPAC name is (3E,6E)-3,6-bis[(3-bromophenyl)methylidene]-1-prop-2-enylpiperazine-2,5-dione.
| Compound Name | (3E,6E)-3,6-bis[(3-bromophenyl)methylidene]-1-prop-2-enylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 90681676 |
| Molecular Formula | C21H16Br2N2O2 |
| Molecular Weight | 488.18 g/mol |
| Exact Mass | 485.96 |
| IUPAC Name | (3E,6E)-3,6-bis[(3-bromophenyl)methylidene]-1-prop-2-enylpiperazine-2,5-dione |
| SMILES | C=CCn1c(=O)/c(=C\c2cccc(Br)c2)[nH]c(=O)/c1=C\c1cccc(Br)c1 |
| InChI | InChI=1S/C21H16Br2N2O2/c1-2-9-25-19(13-15-6-4-8-17(23)11-15)20(26)24-18(21(25)27)12-14-5-3-7-16(22)10-14/h2-8,10-13H,1,9H2,(H,24,26)/b18-12+,19-13+ |
| InChIKey | CVLZGMGLGZSFGW-KLCVKJMQSA-N |
| XLogP | 2.91 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.18 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|